Attributes
UniProt ID
Protein Name
Aldo-keto reductase family 1 member B1
Ligand Name
IDD594
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JCZUIWYXULSXSW-UHFFFAOYSA-N
SMILES
c1cc(c(cc1F)OCC(=O)O)C(=S)NCc2ccc(cc2F)Br
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1US0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1us0A1
ECOD domains from experimental PDB structures interacting with ligand DB08084
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P15121 | DB08084 | LDT | 1us0 | e1us0A1 | A:0-313 |
| P15121 | DB08084 | LDT | 2i16 | e2i16A1 | A:2-314 |
| P15121 | DB08084 | LDT | 2i17 | e2i17A1 | A:2-314 |
| P15121 | DB08084 | LDT | 2pev | e2pevA1 | A:0-313 |
| P15121 | DB08084 | LDT | 2pf8 | e2pf8A1 | A:0-313 |
| P15121 | DB08084 | LDT | 2pfh | e2pfhA1 | A:0-313 |
| P15121 | DB08084 | LDT | 2qxw | e2qxwA1 | A:2-312 |
| P15121 | DB08084 | LDT | 2r24 | e2r24A1 | A:0-315 |
| P15121 | DB08084 | LDT | 3ghr | e3ghrA1 | A:0-315 |
| P15121 | DB08084 | LDT | 3ghs | e3ghsA1 | A:0-315 |
| P15121 | DB08084 | LDT | 3ght | e3ghtA1 | A:0-315 |
| P15121 | DB08084 | LDT | 3ghu | e3ghuA1 | A:0-315 |
| P15121 | DB08084 | LDT | 3lbo | e3lboA1 | A:1-315 |
| P15121 | DB08084 | LDT | 3ld5 | e3ld5A1 | A:2-312 |
| P15121 | DB08084 | LDT | 3lql | e3lqlA1 | A:1-313 |
| P15121 | DB08084 | LDT | 3lz5 | e3lz5A1 | A:0-312 |
| P15121 | DB08084 | LDT | 3onb | e3onbA1 | A:1-312 |
| P15121 | DB08084 | LDT | 3onc | e3oncA1 | A:1-313 |