Attributes
UniProt ID
Protein Name
Poliovirus receptor
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3J8F
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3j8f11e3j8f21e3j8f31e3j8f41e3j8f71e3j8f72e3j8f73
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P15151 | DB00141 | NAG | 3j8f | e3j8f71 | 7:28-142 |
| P15151 | DB00141 | NAG | 3j8f | e3j8f73 | 7:242-333 |
| P15151 | DB00141 | NAG | 3j9f | e3j9f71 | 7:28-143 |
| P15151 | DB00141 | NAG | 3j9f | e3j9f91 | 9:242-333 |
| P15151 | DB00141 | NAG | 3udw | e3udwC1 | C:28-143 |
| P15151 | DB00141 | NAG | 3udw | e3udwD1 | D:28-143 |
| P15151 | DB00141 | NAG | 4fqp | e4fqpA2 | A:28-142 |
| P15151 | DB00141 | NAG | 4fqp | e4fqpA3 | A:242-333 |
| P15151 | DB00141 | NAG | 6arq | e6arqD1 | D:242-330 |
| P15151 | DB00141 | NAG | 6arq | e6arqD2 | D:143-241 |
| P15151 | DB00141 | NAG | 6arq | e6arqD3 | D:28-142 |
| P15151 | DB00141 | NAG | 6isc | e6iscB1 | B:28-145 |
| P15151 | DB00141 | NAG | 6o3o | e6o3oC1 | C:143-241 |
| P15151 | DB00141 | NAG | 6o3o | e6o3oC2 | C:27-142 |
| P15151 | DB00141 | NAG | 6o3o | e6o3oD1 | D:242-329 |
| P15151 | DB00141 | NAG | 6o3o | e6o3oD2 | D:28-142 |
| P15151 | DB00141 | NAG | 6o3o | e6o3oD3 | D:143-241 |