Attributes
UniProt ID
Protein Name
Beta-1,4-galactosyltransferase 1
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2FYB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2fybA1
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P15291 | DB03435 | UDP | 2fyb | e2fybA1 | A:121-398 |
| P15291 | DB03435 | UDP | 4ee4 | e4ee4A1 | A:112-384 |
| P15291 | DB03435 | UDP | 4ee4 | e4ee4B1 | B:112-384 |
| P15291 | DB03435 | UDP | 4ee4 | e4ee4C1 | C:112-384 |
| P15291 | DB03435 | UDP | 4ee5 | e4ee5A1 | A:112-384 |
| P15291 | DB03435 | UDP | 4ee5 | e4ee5B1 | B:112-384 |
| P15291 | DB03435 | UDP | 4ee5 | e4ee5C1 | C:112-384 |
| P15291 | DB03435 | UDP | 4eea | e4eeaA1 | A:112-384 |
| P15291 | DB03435 | UDP | 4eea | e4eeaB1 | B:112-384 |
| P15291 | DB03435 | UDP | 4eea | e4eeaC1 | C:112-384 |
| P15291 | DB03435 | UDP | 4eeg | e4eegA1 | A:112-384 |
| P15291 | DB03435 | UDP | 4eeg | e4eegB1 | B:112-384 |
| P15291 | DB03435 | UDP | 4eeg | e4eegC1 | C:112-384 |
| P15291 | DB03435 | UDP | 4eem | e4eemA1 | A:112-384 |
| P15291 | DB03435 | UDP | 4eem | e4eemB1 | B:112-384 |
| P15291 | DB03435 | UDP | 4eem | e4eemC1 | C:112-384 |
| P15291 | DB03435 | UDP | 4eeo | e4eeoA1 | A:112-384 |
| P15291 | DB03435 | UDP | 4eeo | e4eeoB1 | B:112-384 |
| P15291 | DB03435 | UDP | 4eeo | e4eeoC1 | C:112-384 |