Attributes
UniProt ID
Protein Name
NADPH--cytochrome P450 reductase
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1B1C
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1b1cA1
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P16435 | DB03247 | FMN | 1b1c | e1b1cA1 | A:7-172 |
| P16435 | DB03247 | FMN | 3qe2 | e3qe2A2 | A:69-242 |
| P16435 | DB03247 | FMN | 3qe2 | e3qe2A4 | A:243-328,A:455-521 |
| P16435 | DB03247 | FMN | 3qe2 | e3qe2B2 | B:69-242 |
| P16435 | DB03247 | FMN | 3qe2 | e3qe2B3 | B:522-680 |
| P16435 | DB03247 | FMN | 3qfc | e3qfcA2 | A:243-328,A:455-521 |
| P16435 | DB03247 | FMN | 3qfc | e3qfcA3 | A:69-242 |
| P16435 | DB03247 | FMN | 3qfc | e3qfcB4 | B:243-328,B:455-521 |
| P16435 | DB03247 | FMN | 3qfc | e3qfcB5 | B:70-242 |
| P16435 | DB03247 | FMN | 3qfr | e3qfrA3 | A:70-242 |
| P16435 | DB03247 | FMN | 3qfr | e3qfrB1 | B:70-242 |
| P16435 | DB03247 | FMN | 3qfr | e3qfrB3 | B:522-680 |
| P16435 | DB03247 | FMN | 5emn | e5emnA3 | A:70-242 |
| P16435 | DB03247 | FMN | 5emn | e5emnB2 | B:70-242 |
| P16435 | DB03247 | FMN | 5emn | e5emnB3 | B:522-680 |
| P16435 | DB03247 | FMN | 5fa6 | e5fa6A2 | A:70-242 |
| P16435 | DB03247 | FMN | 5fa6 | e5fa6B1 | B:70-242 |
| P16435 | DB03247 | FMN | 5fa6 | e5fa6B4 | B:522-680 |