Attributes
UniProt ID
Protein Name
Histo-blood group ABO system transferase
Ligand Name
octyl 3-deoxy-2-O-(6-deoxy-alpha-L-galactopyranosyl)-beta-D-xylo-hexopyranoside
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FBVFDKBCZLMLQT-PPCMOIRNSA-N
SMILES
CCCCCCCCOC1C(CC(C(O1)CO)O)OC2C(C(C(C(O2)C)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2RJ7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2rj7A1
ECOD domains from experimental PDB structures interacting with ligand DB07633
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P16442 | DB07633 | DA8 | 2rj7 | e2rj7A1 | A:62-354 |
| P16442 | DB07633 | DA8 | 5bxc | e5bxcA1 | A:58-332 |
| P16442 | DB07633 | DA8 | 5c1g | e5c1gA1 | A:60-351 |
| P16442 | DB07633 | DA8 | 5c1h | e5c1hA1 | A:62-346 |
| P16442 | DB07633 | DA8 | 5c1l | e5c1lA1 | A:62-346 |
| P16442 | DB07633 | DA8 | 5c36 | e5c36A1 | A:58-345 |
| P16442 | DB07633 | DA8 | 5c38 | e5c38A1 | A:61-347 |
| P16442 | DB07633 | DA8 | 5c3b | e5c3bA1 | A:62-346 |
| P16442 | DB07633 | DA8 | 5c47 | e5c47A1 | A:58-347 |
| P16442 | DB07633 | DA8 | 5c48 | e5c48A1 | A:60-346 |
| P16442 | DB07633 | DA8 | 5c4b | e5c4bA1 | A:58-345 |
| P16442 | DB07633 | DA8 | 5c4c | e5c4cA1 | A:58-346 |
| P16442 | DB07633 | DA8 | 5c4d | e5c4dA1 | A:62-346 |
| P16442 | DB07633 | DA8 | 5c4f | e5c4fA1 | A:58-346 |
| P16442 | DB07633 | DA8 | 5c8r | e5c8rA1 | A:60-346 |