Attributes
UniProt ID
Protein Name
Putidaredoxin reductase CamA reductase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1Q1R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1q1rA1e1q1rA2e1q1rA3e1q1rB1e1q1rB2e1q1rB3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P16640 | DB03147 | FAD | 1q1r | e1q1rA1 | A:320-422 |
| P16640 | DB03147 | FAD | 1q1r | e1q1rA2 | A:2-114,A:248-319 |
| P16640 | DB03147 | FAD | 1q1r | e1q1rA3 | A:115-247 |
| P16640 | DB03147 | FAD | 1q1r | e1q1rB1 | B:320-422 |
| P16640 | DB03147 | FAD | 1q1r | e1q1rB2 | B:2-114,B:248-319 |
| P16640 | DB03147 | FAD | 1q1r | e1q1rB3 | B:115-247 |
| P16640 | DB03147 | FAD | 1q1w | e1q1wA1 | A:320-422 |
| P16640 | DB03147 | FAD | 1q1w | e1q1wA2 | A:2-114,A:248-319 |
| P16640 | DB03147 | FAD | 1q1w | e1q1wA3 | A:115-247 |
| P16640 | DB03147 | FAD | 1q1w | e1q1wB1 | B:320-422 |
| P16640 | DB03147 | FAD | 1q1w | e1q1wB2 | B:3-114,B:248-319 |
| P16640 | DB03147 | FAD | 1q1w | e1q1wB3 | B:115-247 |
| P16640 | DB03147 | FAD | 3lb8 | e3lb8A1 | A:320-420 |
| P16640 | DB03147 | FAD | 3lb8 | e3lb8A2 | A:2-114,A:248-319 |
| P16640 | DB03147 | FAD | 3lb8 | e3lb8A3 | A:115-247 |
| P16640 | DB03147 | FAD | 3lb8 | e3lb8B1 | B:320-418 |
| P16640 | DB03147 | FAD | 3lb8 | e3lb8B2 | B:2-114,B:248-319 |
| P16640 | DB03147 | FAD | 3lb8 | e3lb8B3 | B:115-247 |