Attributes
UniProt ID
Protein Name
Cysteine synthase B -lyase B
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2BHS
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2bhsA1e2bhsA2e2bhsB1e2bhsB2e2bhsC1e2bhsC2e2bhsD1e2bhsD2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P16703 | DB00114 | PLP | 2bhs | e2bhsA1 | A:147-293 |
| P16703 | DB00114 | PLP | 2bhs | e2bhsA2 | A:2-146 |
| P16703 | DB00114 | PLP | 2bhs | e2bhsB1 | B:2-146 |
| P16703 | DB00114 | PLP | 2bhs | e2bhsB2 | B:147-292 |
| P16703 | DB00114 | PLP | 2bhs | e2bhsC1 | C:147-292 |
| P16703 | DB00114 | PLP | 2bhs | e2bhsC2 | C:2-146 |
| P16703 | DB00114 | PLP | 2bhs | e2bhsD1 | D:2-146 |
| P16703 | DB00114 | PLP | 2bhs | e2bhsD2 | D:147-292 |
| P16703 | DB00114 | PLP | 2bht | e2bhtA1 | A:1-146 |
| P16703 | DB00114 | PLP | 2bht | e2bhtA2 | A:147-294 |
| P16703 | DB00114 | PLP | 2bht | e2bhtB1 | B:1-146 |
| P16703 | DB00114 | PLP | 2bht | e2bhtB2 | B:147-296 |
| P16703 | DB00114 | PLP | 2bht | e2bhtC1 | C:1-146 |
| P16703 | DB00114 | PLP | 2bht | e2bhtC2 | C:147-292 |
| P16703 | DB00114 | PLP | 2bht | e2bhtD1 | D:1-146 |
| P16703 | DB00114 | PLP | 2bht | e2bhtD2 | D:147-296 |
| P16703 | DB00114 | PLP | 2v03 | e2v03A1 | A:1-146 |
| P16703 | DB00114 | PLP | 2v03 | e2v03A2 | A:147-294 |