Attributes
UniProt ID
Protein Name
Aspartate aminotransferase, cytoplasmic
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3II0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ii0A2e3ii0A3e3ii0B2e3ii0B3e3ii0C2e3ii0C3e3ii0D2e3ii0D3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P17174 | DB00114 | PLP | 3ii0 | e3ii0A3 | A:15-309 |
| P17174 | DB00114 | PLP | 3ii0 | e3ii0B3 | B:15-309 |
| P17174 | DB00114 | PLP | 3ii0 | e3ii0C3 | C:13-324 |
| P17174 | DB00114 | PLP | 3ii0 | e3ii0D3 | D:13-324 |
| P17174 | DB00114 | PLP | 6dna | e6dnaA1 | A:325-410 |
| P17174 | DB00114 | PLP | 6dna | e6dnaA2 | A:16-324 |
| P17174 | DB00114 | PLP | 6dna | e6dnaB1 | B:15-309 |
| P17174 | DB00114 | PLP | 6dna | e6dnaB2 | B:310-410 |
| P17174 | DB00114 | PLP | 6dna | e6dnaC1 | C:12-324 |
| P17174 | DB00114 | PLP | 6dna | e6dnaC2 | C:325-403 |
| P17174 | DB00114 | PLP | 6dna | e6dnaD1 | D:14-324 |
| P17174 | DB00114 | PLP | 6dna | e6dnaE2 | E:17-324 |
| P17174 | DB00114 | PLP | 6dna | e6dnaF1 | F:16-324 |
| P17174 | DB00114 | PLP | 6dnd | e6dndA1 | A:3-324 |
| P17174 | DB00114 | PLP | 6dnd | e6dndA2 | A:325-411 |
| P17174 | DB00114 | PLP | 6dnd | e6dndB1 | B:325-412 |
| P17174 | DB00114 | PLP | 6dnd | e6dndB2 | B:3-324 |
| P17174 | DB00114 | PLP | 6lig | e6ligA1 | A:3-324 |
| P17174 | DB00114 | PLP | 6lig | e6ligB2 | B:3-324 |