Attributes
UniProt ID
Protein Name
26S proteasome regulatory subunit 6A
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5GJQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5gjqB1e5gjqC1e5gjqD1e5gjqE1e5gjqF1e5gjqG1e5gjqH1e5gjqH3e5gjqI1e5gjqI2e5gjqI3e5gjqJ1e5gjqJ2e5gjqJ3e5gjqK1e5gjqK2e5gjqK3e5gjqL1e5gjqL2e5gjqL3e5gjqM1e5gjqM2e5gjqM3e5gjqM4e5gjqN1e5gjqN2e5gjqN3e5gjqO1e5gjqO2e5gjqO3e5gjqP1e5gjqP2e5gjqP3e5gjqQ1e5gjqQ2e5gjqQ3e5gjqR1e5gjqR2e5gjqR3e5gjqT1e5gjqT2e5gjqU2e5gjqU3e5gjqV1e5gjqV2e5gjqW1e5gjqX1e5gjqZ1e5gjqZ3e5gjqa1e5gjqb1e5gjqc1e5gjqd1e5gjqe1e5gjqf1e5gjqg1e5gjqh1e5gjqi1e5gjqj1e5gjqk1e5gjql1e5gjqm1e5gjqn1e5gjqo1e5gjqp1e5gjqq1e5gjqr1e5gjqs1e5gjqt1e5gjqu1e5gjqx1e5gjqy1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P17980 | DB16833 | ADP | 5gjq | e5gjqM1 | M:167-356 |
| P17980 | DB16833 | ADP | 5gjq | e5gjqM3 | M:357-420 |
| P17980 | DB16833 | ADP | 5gjr | e5gjr01 | 0:357-439 |
| P17980 | DB16833 | ADP | 5gjr | e5gjr02 | 0:167-356 |
| P17980 | DB16833 | ADP | 5gjr | e5gjrM1 | M:167-356 |
| P17980 | DB16833 | ADP | 5gjr | e5gjrM2 | M:357-420 |
| P17980 | DB16833 | ADP | 5m32 | e5m32g1 | g:357-439 |
| P17980 | DB16833 | ADP | 5m32 | e5m32g3 | g:167-356 |
| P17980 | DB16833 | ADP | 5t0h | e5t0hF1 | F:167-356 |
| P17980 | DB16833 | ADP | 5t0h | e5t0hF2 | F:357-427 |
| P17980 | DB16833 | ADP | 6msb | e6msbF2 | F:167-356 |
| P17980 | DB16833 | ADP | 6msb | e6msbF3 | F:357-439 |
| P17980 | DB16833 | ADP | 7qxn | e7qxnF2 | F:357-439 |
| P17980 | DB16833 | ADP | 7qxn | e7qxnF3 | F:167-356 |
| P17980 | DB16833 | ADP | 7qxp | e7qxpF2 | F:357-439 |
| P17980 | DB16833 | ADP | 7qxp | e7qxpF3 | F:167-356 |
| P17980 | DB16833 | ADP | 7qxu | e7qxuF1 | F:357-439 |
| P17980 | DB16833 | ADP | 7qxu | e7qxuF3 | F:167-356 |
| P17980 | DB16833 | ADP | 7qxw | e7qxwF3 | F:168-356 |
| P17980 | DB16833 | ADP | 7qxx | e7qxxF1 | F:357-439 |
| P17980 | DB16833 | ADP | 7qxx | e7qxxF3 | F:167-356 |
| P17980 | DB16833 | ADP | 7w37 | e7w37F2 | F:167-356 |
| P17980 | DB16833 | ADP | 7w37 | e7w37F3 | F:357-439 |