Attributes
UniProt ID
Protein Name
26S proteasome regulatory subunit 6A
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5L4G
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5l4g11e5l4g21e5l4g31e5l4g41e5l4g51e5l4g61e5l4g71e5l4g81e5l4gA1e5l4gB1e5l4gC1e5l4gD1e5l4gE1e5l4gF1e5l4gG1e5l4gH2e5l4gH3e5l4gI1e5l4gI2e5l4gI3e5l4gJ1e5l4gJ2e5l4gJ3e5l4gK1e5l4gK2e5l4gK3e5l4gL1e5l4gL2e5l4gL3e5l4gM1e5l4gM2e5l4gM3e5l4gN1e5l4gO1e5l4gP1e5l4gQ1e5l4gR1e5l4gS1e5l4gT1e5l4gU1e5l4gV1e5l4gW1e5l4gX1e5l4gY1e5l4gZ1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P17980 | DB00171 | ATP | 5l4g | e5l4gM1 | M:168-356 |
| P17980 | DB00171 | ATP | 5l4g | e5l4gM2 | M:357-439 |
| P17980 | DB00171 | ATP | 5t0c | e5t0cAF1 | AF:168-356 |
| P17980 | DB00171 | ATP | 5t0c | e5t0cAF2 | AF:357-424 |
| P17980 | DB00171 | ATP | 5t0c | e5t0cBF1 | BF:168-356 |
| P17980 | DB00171 | ATP | 5t0c | e5t0cBF2 | BF:357-424 |
| P17980 | DB00171 | ATP | 5t0g | e5t0gF1 | F:168-356 |
| P17980 | DB00171 | ATP | 5t0g | e5t0gF2 | F:357-424 |
| P17980 | DB00171 | ATP | 5t0i | e5t0iF1 | F:168-356 |
| P17980 | DB00171 | ATP | 5t0i | e5t0iF2 | F:357-424 |
| P17980 | DB00171 | ATP | 5t0j | e5t0jF1 | F:168-356 |
| P17980 | DB00171 | ATP | 5t0j | e5t0jF2 | F:357-424 |
| P17980 | DB00171 | ATP | 6msb | e6msbF2 | F:167-356 |
| P17980 | DB00171 | ATP | 7qxn | e7qxnF3 | F:167-356 |
| P17980 | DB00171 | ATP | 7qxp | e7qxpF3 | F:167-356 |
| P17980 | DB00171 | ATP | 7qxu | e7qxuF3 | F:167-356 |
| P17980 | DB00171 | ATP | 7qxw | e7qxwF1 | F:357-439 |
| P17980 | DB00171 | ATP | 7qxw | e7qxwF3 | F:168-356 |
| P17980 | DB00171 | ATP | 7qxx | e7qxxF3 | F:167-356 |
| P17980 | DB00171 | ATP | 7qya | e7qyaF2 | F:167-356 |
| P17980 | DB00171 | ATP | 7qya | e7qyaF3 | F:357-439 |
| P17980 | DB00171 | ATP | 7w37 | e7w37F2 | F:167-356 |
| P17980 | DB00171 | ATP | 8cvt | e8cvtF1 | F:167-356 |
| P17980 | DB00171 | ATP | 8cvt | e8cvtF3 | F:357-439 |