Attributes
UniProt ID
Protein Name
Tyrosine-protein phosphatase non-receptor type 1
Ligand Name
2-(OXALYL-AMINO)-4,5,6,7-TETRAHYDRO-THIENO[2,3-C]PYRIDINE-3-CARBOXYLIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZIBMATWHOAGNTR-UHFFFAOYSA-N
SMILES
C1CNCc2c1c(c(s2)NC(=O)C(=O)O)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1C88
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1c88A1
ECOD domains from experimental PDB structures interacting with ligand DB03670
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P18031 | DB03670 | OTA | 1c88 | e1c88A1 | A:2-298 |
| P18031 | DB03670 | OTA | 5k9w | e5k9wA1 | A:0-297 |
| P18031 | DB03670 | OTA | 5ka1 | e5ka1A1 | A:-1-282 |
| P18031 | DB03670 | OTA | 5ka3 | e5ka3A1 | A:2-296 |
| P18031 | DB03670 | OTA | 5ka7 | e5ka7A1 | A:0-297 |
| P18031 | DB03670 | OTA | 5ka9 | e5ka9A1 | A:-4-294 |
| P18031 | DB03670 | OTA | 5kab | e5kabA1 | A:1-282 |
| P18031 | DB03670 | OTA | 5kad | e5kadA1 | A:-3-281 |
| P18031 | DB03670 | OTA | 5kad | e5kadB1 | B:-2-282 |
| P18031 | DB03670 | OTA | 7mm1 | e7mm1A1 | A:1-298 |
| P18031 | DB03670 | OTA | 7mn7 | e7mn7A1 | A:0-299 |
| P18031 | DB03670 | OTA | 7mna | e7mnaA1 | A:2-280 |
| P18031 | DB03670 | OTA | 7mnb | e7mnbA1 | A:1-298 |
| P18031 | DB03670 | OTA | 7mnd | e7mndA1 | A:0-298 |
| P18031 | DB03670 | OTA | 7mnf | e7mnfA1 | A:2-280 |
| P18031 | DB03670 | OTA | 7mow | e7mowA1 | A:-1-298 |