Attributes
UniProt ID
Protein Name
Gamma-aminobutyric acid receptor subunit gamma-2 receptor subunit gamma-2
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6D6T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6d6tA1e6d6tA2e6d6tB1e6d6tB2e6d6tC1e6d6tC2e6d6tD1e6d6tD2e6d6tE1e6d6tI1e6d6tJ1e6d6tK1e6d6tL1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P18507 | DB00141 | NAG | 6d6t | e6d6tE1 | E:25-302 |
| P18507 | DB00141 | NAG | 6x3s | e6x3sE2 | E:25-232 |
| P18507 | DB00141 | NAG | 6x3t | e6x3tE1 | E:25-232 |
| P18507 | DB00141 | NAG | 6x3u | e6x3uE1 | E:25-232 |
| P18507 | DB00141 | NAG | 6x3v | e6x3vE2 | E:25-232 |
| P18507 | DB00141 | NAG | 6x3w | e6x3wE2 | E:25-232 |
| P18507 | DB00141 | NAG | 6x3x | e6x3xE2 | E:25-232 |
| P18507 | DB00141 | NAG | 6x3z | e6x3zE2 | E:25-232 |
| P18507 | DB00141 | NAG | 6x40 | e6x40E1 | E:25-232 |
| P18507 | DB00141 | NAG | 7t0z | e7t0zE2 | E:24-232 |
| P18507 | DB00141 | NAG | 8bhg | e8bhgB1 | B:23-232 |
| P18507 | DB00141 | NAG | 8dd2 | e8dd2E2 | E:25-232 |
| P18507 | DB00141 | NAG | 8dd3 | e8dd3E2 | E:25-232 |
| P18507 | DB00141 | NAG | 8sgo | e8sgoE2 | E:25-232 |
| P18507 | DB00141 | NAG | 8si9 | e8si9E2 | E:25-232 |
| P18507 | DB00141 | NAG | 8sid | e8sidE2 | E:25-232 |