Attributes
UniProt ID
Protein Name
DNA ligase 1
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1X9N
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1x9nA1e1x9nA2e1x9nA3e1x9nA4
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P18858 | DB00131 | AMP | 1x9n | e1x9nA4 | A:534-753 |
| P18858 | DB00131 | AMP | 6p09 | e6p09A1 | A:534-753 |
| P18858 | DB00131 | AMP | 6p0a | e6p0aA4 | A:534-753 |
| P18858 | DB00131 | AMP | 6p0b | e6p0bA4 | A:534-753 |
| P18858 | DB00131 | AMP | 6p0c | e6p0cA3 | A:534-753 |
| P18858 | DB00131 | AMP | 6p0d | e6p0dA1 | A:534-753 |
| P18858 | DB00131 | AMP | 6p0e | e6p0eA4 | A:534-753 |
| P18858 | DB00131 | AMP | 6q1v | e6q1vA3 | A:534-753 |
| P18858 | DB00131 | AMP | 7kr3 | e7kr3A1 | A:534-753 |
| P18858 | DB00131 | AMP | 7kr4 | e7kr4A1 | A:534-753 |
| P18858 | DB00131 | AMP | 7l34 | e7l34A2 | A:534-753 |
| P18858 | DB00131 | AMP | 7l35 | e7l35A2 | A:534-753 |
| P18858 | DB00131 | AMP | 7qnz | e7qnzA2 | A:534-753 |
| P18858 | DB00131 | AMP | 7qo1 | e7qo1A3 | A:534-753 |
| P18858 | DB00131 | AMP | 7sum | e7sumA1 | A:534-753 |
| P18858 | DB00131 | AMP | 7sx5 | e7sx5A3 | A:534-753 |
| P18858 | DB00131 | AMP | 7sxe | e7sxeA2 | A:534-753 |