Attributes
UniProt ID
Protein Name
Chorismate mutase AroH
Ligand Name
8-HYDROXY-2-OXA-BICYCLO[3.3.1]NON-6-ENE-3,5-DICARBOXYLIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KRZHNRULRHECRF-JQCUSGDOSA-N
SMILES
C1C2C(C=CC1(CC(O2)C(=O)O)C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2CHT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2chtA1e2chtB1e2chtC1e2chtD1e2chtE1e2chtF1e2chtG1e2chtH1e2chtI1e2chtJ1e2chtK1e2chtL1
ECOD domains from experimental PDB structures interacting with ligand DB08648
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19080 | DB08648 | TSA | 2cht | e2chtA1 | A:2-115 |
| P19080 | DB08648 | TSA | 2cht | e2chtB1 | B:2-118 |
| P19080 | DB08648 | TSA | 2cht | e2chtC1 | C:2-119 |
| P19080 | DB08648 | TSA | 2cht | e2chtD1 | D:2-115 |
| P19080 | DB08648 | TSA | 2cht | e2chtE1 | E:2-118 |
| P19080 | DB08648 | TSA | 2cht | e2chtF1 | F:2-119 |
| P19080 | DB08648 | TSA | 2cht | e2chtG1 | G:2-116 |
| P19080 | DB08648 | TSA | 2cht | e2chtH1 | H:2-117 |
| P19080 | DB08648 | TSA | 2cht | e2chtI1 | I:2-115 |
| P19080 | DB08648 | TSA | 2cht | e2chtJ1 | J:2-118 |
| P19080 | DB08648 | TSA | 2cht | e2chtK1 | K:2-118 |
| P19080 | DB08648 | TSA | 2cht | e2chtL1 | L:2-115 |
| P19080 | DB08648 | TSA | 3zp4 | e3zp4A1 | A:1-117 |
| P19080 | DB08648 | TSA | 3zp4 | e3zp4B1 | B:1-117 |
| P19080 | DB08648 | TSA | 3zp4 | e3zp4C1 | C:1-117 |
| P19080 | DB08648 | TSA | 3zp4 | e3zp4D1 | D:1-117 |
| P19080 | DB08648 | TSA | 3zp4 | e3zp4E1 | E:1-117 |
| P19080 | DB08648 | TSA | 3zp4 | e3zp4F1 | F:1-117 |