Attributes
UniProt ID
Protein Name
Fatty acid synthase subunit alpha reductase ; 3-oxoacyl- synthase ]
Ligand Name
[(3~{R})-4-azanyl-2,2-dimethyl-3-oxidanyl-4-oxidanylidene-butyl] dihydrogen phosphate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UUMQHJQLVJSTLV-BYPYZUCNSA-N
SMILES
CC(C)(COP(=O)(O)O)C(C(=O)N)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6QL6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ql6A1e6ql6A3e6ql6A4e6ql6A5e6ql6A6e6ql6A7e6ql6B1e6ql6B2e6ql6B3e6ql6B5e6ql6B6e6ql6B7e6ql6C1e6ql6C2e6ql6C3e6ql6C4e6ql6C5e6ql6C6e6ql6D1e6ql6D2e6ql6D4e6ql6D5e6ql6D6e6ql6D7e6ql6E1e6ql6E2e6ql6E3e6ql6E5e6ql6E6e6ql6E7e6ql6F1e6ql6F3e6ql6F4e6ql6F5e6ql6F6e6ql6F7e6ql6G1e6ql6G10e6ql6G11e6ql6G2e6ql6G3e6ql6G4e6ql6G5e6ql6G6e6ql6G7e6ql6G8e6ql6G9e6ql6H1e6ql6H10e6ql6H11e6ql6H2e6ql6H3e6ql6H4e6ql6H5e6ql6H6e6ql6H7e6ql6H8e6ql6H9e6ql6I1e6ql6I10e6ql6I11e6ql6I2e6ql6I3e6ql6I4e6ql6I5e6ql6I6e6ql6I7e6ql6I8e6ql6I9e6ql6J1e6ql6J10e6ql6J11e6ql6J2e6ql6J3e6ql6J4e6ql6J5e6ql6J6e6ql6J7e6ql6J8e6ql6J9e6ql6K1e6ql6K10e6ql6K11e6ql6K2e6ql6K3e6ql6K4e6ql6K5e6ql6K6e6ql6K7e6ql6K8e6ql6K9e6ql6L1e6ql6L10e6ql6L11e6ql6L2e6ql6L3e6ql6L4e6ql6L5e6ql6L6e6ql6L7e6ql6L8e6ql6L9
ECOD domains from experimental PDB structures interacting with ligand J8T
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19097 | n/a | J8T | 6ql6 | e6ql6A3 | A:140-302 |
| P19097 | n/a | J8T | 6ql6 | e6ql6A5 | A:1399-1746 |
| P19097 | n/a | J8T | 6ql6 | e6ql6A7 | A:983-1398 |
| P19097 | n/a | J8T | 6ql6 | e6ql6B1 | B:140-302 |
| P19097 | n/a | J8T | 6ql6 | e6ql6B5 | B:1399-1746 |
| P19097 | n/a | J8T | 6ql6 | e6ql6B6 | B:983-1398 |
| P19097 | n/a | J8T | 6ql6 | e6ql6C3 | C:983-1398 |
| P19097 | n/a | J8T | 6ql6 | e6ql6C4 | C:1399-1746 |
| P19097 | n/a | J8T | 6ql6 | e6ql6C5 | C:140-302 |
| P19097 | n/a | J8T | 6ql6 | e6ql6D1 | D:140-302 |
| P19097 | n/a | J8T | 6ql6 | e6ql6D4 | D:983-1398 |
| P19097 | n/a | J8T | 6ql6 | e6ql6D5 | D:1399-1746 |
| P19097 | n/a | J8T | 6ql6 | e6ql6E2 | E:1399-1746 |
| P19097 | n/a | J8T | 6ql6 | e6ql6E3 | E:983-1398 |
| P19097 | n/a | J8T | 6ql6 | e6ql6E5 | E:140-302 |
| P19097 | n/a | J8T | 6ql6 | e6ql6F1 | F:1399-1746 |
| P19097 | n/a | J8T | 6ql6 | e6ql6F3 | F:983-1398 |
| P19097 | n/a | J8T | 6ql6 | e6ql6F7 | F:140-302 |