Attributes
UniProt ID
Protein Name
Heat shock cognate 71 kDa protein
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1KAX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1kaxA1e1kaxA2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19120 | DB00171 | ATP | 1kax | e1kaxA1 | A:4-188 |
| P19120 | DB00171 | ATP | 1kax | e1kaxA2 | A:189-381 |
| P19120 | DB00171 | ATP | 1kay | e1kayA1 | A:4-188 |
| P19120 | DB00171 | ATP | 1kay | e1kayA2 | A:189-381 |
| P19120 | DB00171 | ATP | 1kaz | e1kazA1 | A:4-188 |
| P19120 | DB00171 | ATP | 1kaz | e1kazA2 | A:189-381 |
| P19120 | DB00171 | ATP | 1nge | e1ngeA1 | A:4-188 |
| P19120 | DB00171 | ATP | 1nge | e1ngeA2 | A:189-381 |
| P19120 | DB00171 | ATP | 1ngf | e1ngfA1 | A:4-188 |
| P19120 | DB00171 | ATP | 1ngf | e1ngfA2 | A:189-381 |
| P19120 | DB00171 | ATP | 1ngg | e1nggA1 | A:4-188 |
| P19120 | DB00171 | ATP | 1ngg | e1nggA2 | A:189-381 |
| P19120 | DB00171 | ATP | 1ngh | e1nghA1 | A:4-188 |
| P19120 | DB00171 | ATP | 1ngh | e1nghA2 | A:189-381 |
| P19120 | DB00171 | ATP | 2bup | e2bupA1 | A:4-188 |
| P19120 | DB00171 | ATP | 2bup | e2bupA2 | A:189-381 |