Attributes
UniProt ID
Protein Name
Glutamate receptor 1
Ligand Name
CYCLOTHIAZIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BOCUKUHCLICSIY-KSCJFIISSA-N
SMILES
c1c2c(cc(c1Cl)S(=O)(=O)N)S(=O)(=O)NC(N2)C3CC4CC3C=C4
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7OCF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7ocfA1e7ocfA2e7ocfB1e7ocfB2e7ocfC1e7ocfC2e7ocfD1e7ocfD2e7ocfI1e7ocfJ1
ECOD domains from experimental PDB structures interacting with ligand DB00606
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19490 | DB00606 | CYZ | 7ocf | e7ocfA1 | A:508-543,A:565-815 |
| P19490 | DB00606 | CYZ | 7ocf | e7ocfA2 | A:390-507 |
| P19490 | DB00606 | CYZ | 7ocf | e7ocfC1 | C:508-543,C:565-815 |
| P19490 | DB00606 | CYZ | 7ocf | e7ocfC2 | C:390-507 |
| P19490 | DB00606 | CYZ | 7qhb | e7qhbA1 | A:508-542,A:565-815 |
| P19490 | DB00606 | CYZ | 7qhb | e7qhbA2 | A:388-507 |
| P19490 | DB00606 | CYZ | 7qhb | e7qhbC1 | C:508-542,C:565-815 |
| P19490 | DB00606 | CYZ | 7qhb | e7qhbC2 | C:388-507 |
| P19490 | DB00606 | CYZ | 8ayo | e8ayoA1 | A:508-543,A:565-815 |
| P19490 | DB00606 | CYZ | 8ayo | e8ayoA2 | A:389-507 |
| P19490 | DB00606 | CYZ | 8ayo | e8ayoC1 | C:389-507 |
| P19490 | DB00606 | CYZ | 8ayo | e8ayoC2 | C:508-543,C:565-815 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pA1 | A:389-507 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pA2 | A:508-543,A:565-815 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pB1 | B:389-507 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pB2 | B:508-543,B:565-815 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pC1 | C:389-507 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pC2 | C:508-543,C:565-815 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pD1 | D:389-507 |
| P19490 | DB00606 | CYZ | 8c1p | e8c1pD2 | D:508-543,D:565-815 |