Attributes
UniProt ID
Protein Name
Glutamate receptor 1
Ligand Name
(2R)-2,3-dihydroxypropyl (9Z)-octadec-9-enoate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RZRNAYUHWVFMIP-GDCKJWNLSA-N
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6QKC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6qkcA1e6qkcA2e6qkcB1e6qkcB2e6qkcC1e6qkcC2e6qkcD1e6qkcD2e6qkcI1e6qkcJ1
ECOD domains from experimental PDB structures interacting with ligand OLC
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19490 | n/a | OLC | 6qkc | e6qkcA1 | A:508-543,A:565-813 |
| P19490 | n/a | OLC | 6qkc | e6qkcC1 | C:508-543,C:565-813 |
| P19490 | n/a | OLC | 7qhb | e7qhbA1 | A:508-542,A:565-815 |
| P19490 | n/a | OLC | 7qhb | e7qhbC1 | C:508-542,C:565-815 |
| P19490 | n/a | OLC | 7qhh | e7qhhA2 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 7qhh | e7qhhC2 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8ayl | e8aylA2 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 8ayl | e8aylC2 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8aym | e8aymA1 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 8aym | e8aymC2 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8ayn | e8aynA1 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 8ayn | e8aynC1 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8ayo | e8ayoA1 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 8ayo | e8ayoC2 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8c1p | e8c1pA2 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 8c1p | e8c1pB2 | B:508-543,B:565-815 |
| P19490 | n/a | OLC | 8c1p | e8c1pC2 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8c1p | e8c1pD2 | D:508-543,D:565-815 |
| P19490 | n/a | OLC | 8c1q | e8c1qA2 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 8c1q | e8c1qB1 | B:508-544,B:566-815 |
| P19490 | n/a | OLC | 8c1q | e8c1qC2 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8c1q | e8c1qD2 | D:508-544,D:566-815 |
| P19490 | n/a | OLC | 8c2h | e8c2hA1 | A:506-542,A:565-623,A:779-815 |
| P19490 | n/a | OLC | 8c2h | e8c2hB1 | B:506-543,B:565-623,B:779-815 |
| P19490 | n/a | OLC | 8c2h | e8c2hC1 | C:506-543,C:565-623,C:779-815 |
| P19490 | n/a | OLC | 8c2h | e8c2hD1 | D:502-543,D:565-626,D:779-815 |
| P19490 | n/a | OLC | 8c2i | e8c2iA1 | A:506-624,A:778-815 |
| P19490 | n/a | OLC | 8c2i | e8c2iB1 | B:506-545,B:566-626,B:780-815 |
| P19490 | n/a | OLC | 8c2i | e8c2iC1 | C:504-625,C:778-815 |
| P19490 | n/a | OLC | 8c2i | e8c2iD1 | D:506-545,D:566-626,D:780-815 |
| P19490 | n/a | OLC | 8p3w | e8p3wA1 | A:508-543,A:565-815 |
| P19490 | n/a | OLC | 8p3w | e8p3wB1 | B:508-544,B:566-815 |
| P19490 | n/a | OLC | 8p3w | e8p3wC2 | C:508-543,C:565-815 |
| P19490 | n/a | OLC | 8p3w | e8p3wD2 | D:508-544,D:566-815 |