Attributes
UniProt ID
Protein Name
Glutamate receptor 2
Ligand Name
3-(5-nitro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-L-alanine
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IEBVITXSHAFLJR-VKHMYHEASA-N
SMILES
C1=C(C(=O)NC(=O)N1CC(C(=O)O)N)[N+](=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3RTW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3rtwB1e3rtwB2e3rtwD1e3rtwD2e3rtwF1e3rtwF2
ECOD domains from experimental PDB structures interacting with ligand NWD
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19491 | n/a | NWD | 3rtw | e3rtwB1 | B:4-108,B:219-261 |
| P19491 | n/a | NWD | 3rtw | e3rtwB2 | B:109-218 |
| P19491 | n/a | NWD | 3rtw | e3rtwD1 | D:109-218 |
| P19491 | n/a | NWD | 3rtw | e3rtwD2 | D:4-108,D:219-261 |
| P19491 | n/a | NWD | 3rtw | e3rtwF1 | F:109-218 |
| P19491 | n/a | NWD | 3rtw | e3rtwF2 | F:4-108,F:219-261 |
| P19491 | n/a | NWD | 4q30 | e4q30B1 | B:4-108,B:219-261 |
| P19491 | n/a | NWD | 4q30 | e4q30B2 | B:109-218 |
| P19491 | n/a | NWD | 4q30 | e4q30D1 | D:4-108,D:219-261 |
| P19491 | n/a | NWD | 4q30 | e4q30D2 | D:109-218 |
| P19491 | n/a | NWD | 4q30 | e4q30F1 | F:4-108,F:219-261 |
| P19491 | n/a | NWD | 4q30 | e4q30F2 | F:109-218 |
| P19491 | n/a | NWD | 4u4f | e4u4fA3 | A:392-497,A:731-773 |
| P19491 | n/a | NWD | 4u4f | e4u4fA5 | A:498-506,A:631-730 |
| P19491 | n/a | NWD | 4u4f | e4u4fB1 | B:392-497,B:731-773 |
| P19491 | n/a | NWD | 4u4f | e4u4fB5 | B:498-506,B:631-730 |
| P19491 | n/a | NWD | 4u4f | e4u4fC5 | C:392-497,C:731-773 |
| P19491 | n/a | NWD | 4u4f | e4u4fC6 | C:498-506,C:631-730 |
| P19491 | n/a | NWD | 4u4f | e4u4fD1 | D:498-506,D:631-730 |
| P19491 | n/a | NWD | 4u4f | e4u4fD5 | D:392-497,D:731-773 |