Attributes
UniProt ID
Protein Name
DNA polymerase I, thermostable
Ligand Name
2',3'-DIDEOXYCYTIDINE 5'-TRIPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ARLKCWCREKRROD-POYBYMJQSA-N
SMILES
C1CC(OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N2C=CC(=NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2KTQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2ktqA2e2ktqA3e2ktqA6e2ktqA7
ECOD domains from experimental PDB structures interacting with ligand DCT
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19821 | n/a | DCT | 2ktq | e2ktqA2 | A:423-600 |
| P19821 | n/a | DCT | 2ktq | e2ktqA6 | A:626-749 |
| P19821 | n/a | DCT | 2ktq | e2ktqA7 | A:601-630,A:750-832 |
| P19821 | n/a | DCT | 3ktq | e3ktqA1 | A:625-748 |
| P19821 | n/a | DCT | 3ktq | e3ktqA2 | A:423-600 |
| P19821 | n/a | DCT | 3ktq | e3ktqA3 | A:601-624,A:749-830 |
| P19821 | n/a | DCT | 3py8 | e3py8A1 | A:616-739 |
| P19821 | n/a | DCT | 3py8 | e3py8A2 | A:423-591 |
| P19821 | n/a | DCT | 3py8 | e3py8A3 | A:592-615,A:740-832 |
| P19821 | n/a | DCT | 4bwj | e4bwjA1 | A:616-739 |
| P19821 | n/a | DCT | 4bwj | e4bwjA2 | A:423-591 |
| P19821 | n/a | DCT | 4bwj | e4bwjA3 | A:592-615,A:740-832 |
| P19821 | n/a | DCT | 4bwm | e4bwmA1 | A:616-739 |
| P19821 | n/a | DCT | 4bwm | e4bwmA3 | A:592-615,A:740-832 |
| P19821 | n/a | DCT | 4dle | e4dleA10 | A:423-600 |
| P19821 | n/a | DCT | 4dle | e4dleA11 | A:626-749 |
| P19821 | n/a | DCT | 4dle | e4dleA12 | A:601-630,A:750-832 |
| P19821 | n/a | DCT | 4dlg | e4dlgA1 | A:616-739 |
| P19821 | n/a | DCT | 4dlg | e4dlgA2 | A:423-591 |
| P19821 | n/a | DCT | 4dlg | e4dlgA3 | A:592-615,A:740-832 |
| P19821 | n/a | DCT | 4n5s | e4n5sA1 | A:601-624,A:749-831 |
| P19821 | n/a | DCT | 4n5s | e4n5sA2 | A:625-748 |
| P19821 | n/a | DCT | 4n5s | e4n5sA3 | A:423-600 |