Attributes
UniProt ID
Protein Name
DNA polymerase I, thermostable
Ligand Name
2',3'-dideoxyadenosine triphosphate
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OAKPWEUQDVLTCN-NKWVEPMBSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3CCC(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1QSY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1qsyA1e1qsyA2e1qsyA3e1qsyA4
ECOD domains from experimental PDB structures interacting with ligand DB02189
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19821 | DB02189 | DDS | 1qsy | e1qsyA1 | A:625-748 |
| P19821 | DB02189 | DDS | 1qsy | e1qsyA2 | A:423-600 |
| P19821 | DB02189 | DDS | 1qsy | e1qsyA3 | A:601-624,A:749-830 |
| P19821 | DB02189 | DDS | 3lwl | e3lwlA1 | A:625-748 |
| P19821 | DB02189 | DDS | 3lwl | e3lwlA2 | A:423-600 |
| P19821 | DB02189 | DDS | 3lwl | e3lwlA3 | A:601-624,A:749-832 |
| P19821 | DB02189 | DDS | 3lwm | e3lwmA1 | A:616-739 |
| P19821 | DB02189 | DDS | 3lwm | e3lwmA2 | A:423-591 |
| P19821 | DB02189 | DDS | 3lwm | e3lwmA3 | A:592-615,A:740-832 |
| P19821 | DB02189 | DDS | 3po4 | e3po4A1 | A:625-744 |
| P19821 | DB02189 | DDS | 3po4 | e3po4A2 | A:423-600 |
| P19821 | DB02189 | DDS | 3po4 | e3po4A3 | A:601-624,A:745-832 |
| P19821 | DB02189 | DDS | 3po5 | e3po5A1 | A:423-606 |
| P19821 | DB02189 | DDS | 3po5 | e3po5A3 | A:607-745 |
| P19821 | DB02189 | DDS | 3po5 | e3po5A4 | A:746-832 |