Attributes
UniProt ID
Protein Name
Carbon monoxide dehydrogenase large chain
Ligand Name
PTERIN CYTOSINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RBWYFPNWTRZKKZ-LOIMWUFNSA-N
SMILES
C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OCC3C(=C(c4c(nc5c(n4)c(nc(n5)N)O)O3)S)S)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1N5W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1n5wA1e1n5wA2e1n5wB1e1n5wB2e1n5wB3e1n5wC1e1n5wC2e1n5wD1e1n5wD2e1n5wE2e1n5wE3e1n5wE4e1n5wF1e1n5wF2
ECOD domains from experimental PDB structures interacting with ligand DB03300
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19919 | DB03300 | MCN | 1n5w | e1n5wB1 | B:147-433 |
| P19919 | DB03300 | MCN | 1n5w | e1n5wB3 | B:434-809 |
| P19919 | DB03300 | MCN | 1n5w | e1n5wE3 | E:434-809 |
| P19919 | DB03300 | MCN | 1n5w | e1n5wE4 | E:147-433 |
| P19919 | DB03300 | MCN | 1n60 | e1n60B3 | B:147-433 |
| P19919 | DB03300 | MCN | 1n60 | e1n60B4 | B:434-809 |
| P19919 | DB03300 | MCN | 1n60 | e1n60E1 | E:147-433 |
| P19919 | DB03300 | MCN | 1n60 | e1n60E3 | E:434-809 |
| P19919 | DB03300 | MCN | 1n61 | e1n61B1 | B:434-809 |
| P19919 | DB03300 | MCN | 1n61 | e1n61B3 | B:147-433 |
| P19919 | DB03300 | MCN | 1n61 | e1n61E3 | E:434-809 |
| P19919 | DB03300 | MCN | 1n61 | e1n61E4 | E:147-433 |
| P19919 | DB03300 | MCN | 1n62 | e1n62B3 | B:147-433 |
| P19919 | DB03300 | MCN | 1n62 | e1n62B4 | B:434-809 |
| P19919 | DB03300 | MCN | 1n62 | e1n62E1 | E:434-809 |
| P19919 | DB03300 | MCN | 1n62 | e1n62E3 | E:147-433 |
| P19919 | DB03300 | MCN | 1n63 | e1n63B1 | B:434-809 |
| P19919 | DB03300 | MCN | 1n63 | e1n63B3 | B:147-433 |
| P19919 | DB03300 | MCN | 1n63 | e1n63E1 | E:147-433 |
| P19919 | DB03300 | MCN | 1n63 | e1n63E3 | E:434-809 |
| P19919 | DB03300 | MCN | 1zxi | e1zxiB3 | B:147-433 |
| P19919 | DB03300 | MCN | 1zxi | e1zxiB4 | B:434-809 |
| P19919 | DB03300 | MCN | 1zxi | e1zxiE1 | E:147-433 |
| P19919 | DB03300 | MCN | 1zxi | e1zxiE3 | E:434-809 |