Attributes
UniProt ID
Protein Name
Carbon monoxide dehydrogenase medium chain
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1N5W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1n5wA1e1n5wA2e1n5wB1e1n5wB2e1n5wB3e1n5wC1e1n5wC2e1n5wD1e1n5wD2e1n5wE2e1n5wE3e1n5wE4e1n5wF1e1n5wF2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19920 | DB03147 | FAD | 1n5w | e1n5wC1 | C:178-286 |
| P19920 | DB03147 | FAD | 1n5w | e1n5wC2 | C:1-177 |
| P19920 | DB03147 | FAD | 1n5w | e1n5wF1 | F:178-286 |
| P19920 | DB03147 | FAD | 1n5w | e1n5wF2 | F:1-177 |
| P19920 | DB03147 | FAD | 1n60 | e1n60C1 | C:178-286 |
| P19920 | DB03147 | FAD | 1n60 | e1n60C2 | C:1-177 |
| P19920 | DB03147 | FAD | 1n60 | e1n60F1 | F:178-286 |
| P19920 | DB03147 | FAD | 1n60 | e1n60F2 | F:1-177 |
| P19920 | DB03147 | FAD | 1n61 | e1n61C1 | C:178-286 |
| P19920 | DB03147 | FAD | 1n61 | e1n61C2 | C:1-177 |
| P19920 | DB03147 | FAD | 1n61 | e1n61F1 | F:178-286 |
| P19920 | DB03147 | FAD | 1n61 | e1n61F2 | F:1-177 |
| P19920 | DB03147 | FAD | 1n62 | e1n62C1 | C:178-286 |
| P19920 | DB03147 | FAD | 1n62 | e1n62C2 | C:1-177 |
| P19920 | DB03147 | FAD | 1n62 | e1n62F1 | F:178-286 |
| P19920 | DB03147 | FAD | 1n62 | e1n62F2 | F:1-177 |
| P19920 | DB03147 | FAD | 1n63 | e1n63C1 | C:178-286 |
| P19920 | DB03147 | FAD | 1n63 | e1n63C2 | C:1-177 |
| P19920 | DB03147 | FAD | 1n63 | e1n63F1 | F:178-286 |
| P19920 | DB03147 | FAD | 1n63 | e1n63F2 | F:1-177 |
| P19920 | DB03147 | FAD | 1zxi | e1zxiC1 | C:178-286 |
| P19920 | DB03147 | FAD | 1zxi | e1zxiC2 | C:1-177 |
| P19920 | DB03147 | FAD | 1zxi | e1zxiF1 | F:178-286 |
| P19920 | DB03147 | FAD | 1zxi | e1zxiF2 | F:1-177 |