Attributes
UniProt ID
Protein Name
Carbon monoxide dehydrogenase small chain
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1N5W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1n5wA1e1n5wA2e1n5wB1e1n5wB2e1n5wB3e1n5wC1e1n5wC2e1n5wD1e1n5wD2e1n5wE2e1n5wE3e1n5wE4e1n5wF1e1n5wF2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P19921 | DB03147 | FAD | 1n5w | e1n5wA1 | A:82-163 |
| P19921 | DB03147 | FAD | 1n5w | e1n5wA2 | A:3-81 |
| P19921 | DB03147 | FAD | 1n5w | e1n5wD2 | D:3-81 |
| P19921 | DB03147 | FAD | 1n60 | e1n60A1 | A:82-163 |
| P19921 | DB03147 | FAD | 1n60 | e1n60A2 | A:3-81 |
| P19921 | DB03147 | FAD | 1n60 | e1n60D2 | D:3-81 |
| P19921 | DB03147 | FAD | 1n61 | e1n61A1 | A:82-163 |
| P19921 | DB03147 | FAD | 1n61 | e1n61A2 | A:3-81 |
| P19921 | DB03147 | FAD | 1n61 | e1n61D2 | D:3-81 |
| P19921 | DB03147 | FAD | 1n62 | e1n62A1 | A:82-163 |
| P19921 | DB03147 | FAD | 1n62 | e1n62A2 | A:3-81 |
| P19921 | DB03147 | FAD | 1n62 | e1n62D2 | D:3-81 |
| P19921 | DB03147 | FAD | 1n63 | e1n63A1 | A:82-162 |
| P19921 | DB03147 | FAD | 1n63 | e1n63A2 | A:3-81 |
| P19921 | DB03147 | FAD | 1n63 | e1n63D2 | D:3-81 |
| P19921 | DB03147 | FAD | 1zxi | e1zxiA1 | A:85-156 |
| P19921 | DB03147 | FAD | 1zxi | e1zxiA2 | A:3-81 |
| P19921 | DB03147 | FAD | 1zxi | e1zxiD2 | D:3-81 |