Attributes
UniProt ID
Protein Name
HLA class II histocompatibility antigen, DP alpha 1 chain )
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3LQZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3lqzA1e3lqzA2e3lqzB2e3lqzB3
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P20036 | DB00141 | NAG | 3lqz | e3lqzA2 | A:1-81 |
| P20036 | DB00141 | NAG | 4p4k | e4p4kA2 | A:82-179 |
| P20036 | DB00141 | NAG | 4p4k | e4p4kE1 | E:1-81 |
| P20036 | DB00141 | NAG | 4p4r | e4p4rA1 | A:2-81 |
| P20036 | DB00141 | NAG | 4p4r | e4p4rC1 | C:2-81 |
| P20036 | DB00141 | NAG | 4p57 | e4p57A2 | A:82-179 |
| P20036 | DB00141 | NAG | 4p57 | e4p57C2 | C:82-181 |
| P20036 | DB00141 | NAG | 4p5m | e4p5mE2 | E:82-180 |
| P20036 | DB00141 | NAG | 7t2a | e7t2aA2 | A:82-180 |
| P20036 | DB00141 | NAG | 7t2a | e7t2aD1 | D:82-180 |
| P20036 | DB00141 | NAG | 7t2b | e7t2bA2 | A:1-81 |
| P20036 | DB00141 | NAG | 7t2b | e7t2bF2 | F:1-81 |
| P20036 | DB00141 | NAG | 7t2b | e7t2bK2 | K:82-180 |
| P20036 | DB00141 | NAG | 7t2b | e7t2bP2 | P:1-81 |
| P20036 | DB00141 | NAG | 7t2d | e7t2dA1 | A:82-180 |
| P20036 | DB00141 | NAG | 7t2d | e7t2dA2 | A:1-81 |
| P20036 | DB00141 | NAG | 7t2d | e7t2dF2 | F:1-81 |
| P20036 | DB00141 | NAG | 7t2d | e7t2dK1 | K:1-81 |
| P20036 | DB00141 | NAG | 7t2d | e7t2dP1 | P:1-81 |