Attributes
UniProt ID
Protein Name
Transcobalamin-2
Ligand Name
CYANOCOBALAMIN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SYZBZQWSWIJYAR-UVKKECPRSA-M
SMILES
Cc1cc2c(cc1C)n(cn2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C7=[N]6[Co+2]89(N5C4=C(C1=[N]8C(=CC2=[N]9C(=C7C)C(C2CCC(=O)N)(C)CC(=O)N)C(C1CCC(=O)N)(C)C)C)C#N)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4ZRP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4zrpA1e4zrpA2e4zrpB1e4zrpB2e4zrpC1e4zrpC2e4zrpD1e4zrpD2
ECOD domains from experimental PDB structures interacting with ligand DB00115
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P20062 | DB00115 | CNC | 4zrp | e4zrpA1 | A:302-409 |
| P20062 | DB00115 | CNC | 4zrp | e4zrpA2 | A:1-304 |
| P20062 | DB00115 | CNC | 4zrp | e4zrpB1 | B:1-304 |
| P20062 | DB00115 | CNC | 4zrp | e4zrpB2 | B:302-409 |
| P20062 | DB00115 | CNC | 4zrq | e4zrqA1 | A:1-304 |
| P20062 | DB00115 | CNC | 4zrq | e4zrqA2 | A:302-409 |
| P20062 | DB00115 | CNC | 4zrq | e4zrqB1 | B:1-304 |
| P20062 | DB00115 | CNC | 4zrq | e4zrqB2 | B:302-409 |
| P20062 | DB00115 | CNC | 5np4 | e5np4A1 | A:304-409 |
| P20062 | DB00115 | CNC | 7qbd | e7qbdA1 | A:1-304 |
| P20062 | DB00115 | CNC | 7qbd | e7qbdA2 | A:302-409 |
| P20062 | DB00115 | CNC | 7qbd | e7qbdB1 | B:1-304 |
| P20062 | DB00115 | CNC | 7qbd | e7qbdB2 | B:302-409 |
| P20062 | DB00115 | CNC | 7qbe | e7qbeA1 | A:1-304 |
| P20062 | DB00115 | CNC | 7qbe | e7qbeA2 | A:302-409 |
| P20062 | DB00115 | CNC | 7qbe | e7qbeC1 | C:1-304 |
| P20062 | DB00115 | CNC | 7qbe | e7qbeC2 | C:302-409 |
| P20062 | DB00115 | CNC | 7qbf | e7qbfA1 | A:302-409 |
| P20062 | DB00115 | CNC | 7qbf | e7qbfA2 | A:1-304 |
| P20062 | DB00115 | CNC | 7qbg | e7qbgA1 | A:302-409 |
| P20062 | DB00115 | CNC | 7qbg | e7qbgA2 | A:1-304 |
| P20062 | DB00115 | CNC | 7qbg | e7qbgC1 | C:302-409 |
| P20062 | DB00115 | CNC | 7qbg | e7qbgC2 | C:3-304 |