Attributes
UniProt ID
Protein Name
Myeloid cell surface antigen CD33
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5IHB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5ihbA1e5ihbA2e5ihbB1e5ihbB2e5ihbC1e5ihbC2e5ihbD1e5ihbD2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P20138 | DB00141 | NAG | 5ihb | e5ihbA2 | A:140-232 |
| P20138 | DB00141 | NAG | 5ihb | e5ihbB2 | B:140-232 |
| P20138 | DB00141 | NAG | 5ihb | e5ihbC2 | C:140-232 |
| P20138 | DB00141 | NAG | 5ihb | e5ihbD2 | D:140-231 |
| P20138 | DB00141 | NAG | 5j06 | e5j06A2 | A:140-232 |
| P20138 | DB00141 | NAG | 5j06 | e5j06B1 | B:140-232 |
| P20138 | DB00141 | NAG | 5j06 | e5j06C2 | C:140-231 |
| P20138 | DB00141 | NAG | 5j06 | e5j06D2 | D:140-232 |
| P20138 | DB00141 | NAG | 5j0b | e5j0bA2 | A:140-232 |
| P20138 | DB00141 | NAG | 5j0b | e5j0bB2 | B:140-232 |
| P20138 | DB00141 | NAG | 5j0b | e5j0bC2 | C:140-231 |
| P20138 | DB00141 | NAG | 5j0b | e5j0bD2 | D:140-231 |
| P20138 | DB00141 | NAG | 6tl8 | e6tl8C1 | C:16-279 |
| P20138 | DB00141 | NAG | 6tl8 | e6tl8D1 | D:16-284 |
| P20138 | DB00141 | NAG | 7aw6 | e7aw6A2 | A:140-232 |
| P20138 | DB00141 | NAG | 7aw6 | e7aw6B1 | B:140-232 |