Attributes
UniProt ID
Protein Name
Glutamine synthetase 2 cytoplasmic
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7CPR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7cprA1e7cprA2e7cprB1e7cprB2e7cprC1e7cprC2e7cprD1e7cprD2e7cprE1e7cprE2e7cprF1e7cprF2e7cprG1e7cprG2e7cprH1e7cprH2e7cprI1e7cprI2e7cprJ1e7cprJ2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P20478 | DB16833 | ADP | 7cpr | e7cprA1 | A:116-369 |
| P20478 | DB16833 | ADP | 7cpr | e7cprA2 | A:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprB1 | B:116-369 |
| P20478 | DB16833 | ADP | 7cpr | e7cprB2 | B:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprC1 | C:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprC2 | C:116-368 |
| P20478 | DB16833 | ADP | 7cpr | e7cprD1 | D:116-367 |
| P20478 | DB16833 | ADP | 7cpr | e7cprD2 | D:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprE1 | E:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprE2 | E:116-367 |
| P20478 | DB16833 | ADP | 7cpr | e7cprF1 | F:116-369 |
| P20478 | DB16833 | ADP | 7cpr | e7cprF2 | F:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprG1 | G:3-29,G:116-367 |
| P20478 | DB16833 | ADP | 7cpr | e7cprG2 | G:30-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprH1 | H:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprH2 | H:116-368 |
| P20478 | DB16833 | ADP | 7cpr | e7cprI1 | I:116-368 |
| P20478 | DB16833 | ADP | 7cpr | e7cprI2 | I:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprJ1 | J:32-115 |
| P20478 | DB16833 | ADP | 7cpr | e7cprJ2 | J:116-369 |