Attributes
UniProt ID
Protein Name
Cytochrome P450 2B6
Ligand Name
5-CYCLOHEXYL-1-PENTYL-BETA-D-MALTOSIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RVTGFZGNOSKUDA-ZNGNCRBCSA-N
SMILES
C1CCC(CC1)CCCCCOC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3IBD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ibdA1
ECOD domains from experimental PDB structures interacting with ligand DB04664
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P20813 | DB04664 | CM5 | 3ibd | e3ibdA1 | A:28-492 |
| P20813 | DB04664 | CM5 | 3qoa | e3qoaA1 | A:28-492 |
| P20813 | DB04664 | CM5 | 3qu8 | e3qu8A1 | A:28-492 |
| P20813 | DB04664 | CM5 | 3qu8 | e3qu8B1 | B:28-492 |
| P20813 | DB04664 | CM5 | 3qu8 | e3qu8C1 | C:28-492 |
| P20813 | DB04664 | CM5 | 3qu8 | e3qu8D1 | D:28-491 |
| P20813 | DB04664 | CM5 | 3qu8 | e3qu8E1 | E:28-492 |
| P20813 | DB04664 | CM5 | 3qu8 | e3qu8F1 | F:28-486 |
| P20813 | DB04664 | CM5 | 4i91 | e4i91A1 | A:28-492 |
| P20813 | DB04664 | CM5 | 4rql | e4rqlA1 | A:28-492 |
| P20813 | DB04664 | CM5 | 4rql | e4rqlB1 | B:28-492 |
| P20813 | DB04664 | CM5 | 4rrt | e4rrtA1 | A:28-491 |
| P20813 | DB04664 | CM5 | 4rrt | e4rrtB1 | B:28-491 |
| P20813 | DB04664 | CM5 | 4zv8 | e4zv8A1 | A:28-492 |
| P20813 | DB04664 | CM5 | 5uap | e5uapA1 | A:28-491 |
| P20813 | DB04664 | CM5 | 5uap | e5uapB1 | B:29-492 |
| P20813 | DB04664 | CM5 | 5uda | e5udaA1 | A:28-491 |
| P20813 | DB04664 | CM5 | 5uda | e5udaB1 | B:28-491 |
| P20813 | DB04664 | CM5 | 5uec | e5uecA1 | A:28-492 |
| P20813 | DB04664 | CM5 | 5ufg | e5ufgA1 | A:29-492 |
| P20813 | DB04664 | CM5 | 5wbg | e5wbgB1 | B:27-491 |
| P20813 | DB04664 | CM5 | 5wbg | e5wbgC1 | C:27-491 |
| P20813 | DB04664 | CM5 | 5wbg | e5wbgD1 | D:27-491 |
| P20813 | DB04664 | CM5 | 5wbg | e5wbgE1 | E:28-491 |
| P20813 | DB04664 | CM5 | 5wbg | e5wbgF1 | F:27-491 |