Attributes
UniProt ID
Protein Name
Myelin-associated glycoprotein
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5LF5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5lf5A1e5lf5A2e5lf5A3e5lf5A4e5lf5A5
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P20917 | DB00141 | NAG | 5lf5 | e5lf5A3 | A:324-410 |
| P20917 | DB00141 | NAG | 5lfr | e5lfrA1 | A:238-331 |
| P20917 | DB00141 | NAG | 5lfr | e5lfrA2 | A:136-237 |
| P20917 | DB00141 | NAG | 5lfr | e5lfrA3 | A:19-135 |
| P20917 | DB00141 | NAG | 5lfr | e5lfrB1 | B:136-237 |
| P20917 | DB00141 | NAG | 5lfr | e5lfrB2 | B:20-135 |
| P20917 | DB00141 | NAG | 5lfr | e5lfrB3 | B:238-331 |
| P20917 | DB00141 | NAG | 5lfu | e5lfuA1 | A:20-138 |
| P20917 | DB00141 | NAG | 5lfu | e5lfuA2 | A:239-323 |
| P20917 | DB00141 | NAG | 5lfu | e5lfuA3 | A:324-410 |
| P20917 | DB00141 | NAG | 5lfu | e5lfuA4 | A:139-239 |
| P20917 | DB00141 | NAG | 5lfv | e5lfvA1 | A:238-329 |
| P20917 | DB00141 | NAG | 5lfv | e5lfvA2 | A:19-135 |
| P20917 | DB00141 | NAG | 5lfv | e5lfvA3 | A:136-237 |
| P20917 | DB00141 | NAG | 5lfv | e5lfvB1 | B:19-135 |
| P20917 | DB00141 | NAG | 5lfv | e5lfvB2 | B:136-237 |
| P20917 | DB00141 | NAG | 5lfv | e5lfvB3 | B:238-329 |