Attributes
UniProt ID
Protein Name
Alanine--glyoxylate aminotransferase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1H0C
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1h0cA2e1h0cA3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P21549 | DB00114 | PLP | 1h0c | e1h0cA2 | A:4-283 |
| P21549 | DB00114 | PLP | 2yob | e2yobA2 | A:4-283 |
| P21549 | DB00114 | PLP | 2yob | e2yobB2 | B:4-283 |
| P21549 | DB00114 | PLP | 4cbr | e4cbrA1 | A:4-283 |
| P21549 | DB00114 | PLP | 4cbs | e4cbsA1 | A:4-283 |
| P21549 | DB00114 | PLP | 5f9s | e5f9sA1 | A:6-283 |
| P21549 | DB00114 | PLP | 5f9s | e5f9sA2 | A:284-390 |
| P21549 | DB00114 | PLP | 5f9s | e5f9sB1 | B:284-391 |
| P21549 | DB00114 | PLP | 5f9s | e5f9sB2 | B:6-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucA1 | A:4-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucB1 | B:5-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucE1 | E:5-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucG2 | G:5-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucM2 | M:5-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucN1 | N:4-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucS2 | S:5-283 |
| P21549 | DB00114 | PLP | 5luc | e5lucT1 | T:5-283 |
| P21549 | DB00114 | PLP | 5ofy | e5ofyA1 | A:5-283 |
| P21549 | DB00114 | PLP | 5og0 | e5og0A2 | A:4-283 |
| P21549 | DB00114 | PLP | 6rv1 | e6rv1A2 | A:6-283 |