Attributes
UniProt ID
Protein Name
Periplasmic hydrogenase large subunit
Ligand Name
(MU-SULPHIDO)-BIS(MU-CYS,S)-[TRICARBONYLIRON-DI-(CYS,S)NICKEL(II)](FE-NI)
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RSNJUOPWNIKDNA-UHFFFAOYSA-N
SMILES
C(#O)[Fe]1(S[Ni]1)(C#O)C#O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1UBH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ubhL1e1ubhL2e1ubhL3e1ubhL4e1ubhS1e1ubhS2
ECOD domains from experimental PDB structures interacting with ligand FNE
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P21852 | n/a | FNE | 1ubh | e1ubhL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubh | e1ubhL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubh | e1ubhL4 | L:59-101,L:462-510 |
| P21852 | n/a | FNE | 1ubj | e1ubjL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubj | e1ubjL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubj | e1ubjL4 | L:59-101,L:462-510 |
| P21852 | n/a | FNE | 1ubk | e1ubkL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubk | e1ubkL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubk | e1ubkL4 | L:59-101,L:462-510 |
| P21852 | n/a | FNE | 1ubl | e1ublL3 | L:103-330,L:382-462 |
| P21852 | n/a | FNE | 1ubl | e1ublL5 | L:19-59,L:512-552 |
| P21852 | n/a | FNE | 1ubl | e1ublL6 | L:60-102,L:463-511 |
| P21852 | n/a | FNE | 1ubm | e1ubmL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubm | e1ubmL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubm | e1ubmL4 | L:59-101,L:462-510 |
| P21852 | n/a | FNE | 1ubo | e1uboL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubo | e1uboL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubo | e1uboL4 | L:59-101,L:462-510 |
| P21852 | n/a | FNE | 1ubr | e1ubrL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubr | e1ubrL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubr | e1ubrL4 | L:59-101,L:462-510 |
| P21852 | n/a | FNE | 1ubt | e1ubtL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubt | e1ubtL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubt | e1ubtL4 | L:59-101,L:462-510 |
| P21852 | n/a | FNE | 1ubu | e1ubuL2 | L:102-329,L:381-461 |
| P21852 | n/a | FNE | 1ubu | e1ubuL3 | L:19-58,L:511-551 |
| P21852 | n/a | FNE | 1ubu | e1ubuL4 | L:59-101,L:462-510 |