Attributes
UniProt ID
Protein Name
Catechol O-methyltransferase
Ligand Name
S-ADENOSYLMETHIONINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MEFKEPWMEQBLKI-FCKMPRQPSA-N
SMILES
C[S+](CCC(C(=O)[O-])N)CC1C(C(C(O1)n2cnc3c2ncnc3N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1H1D
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1h1dA1
ECOD domains from experimental PDB structures interacting with ligand DB00118
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P22734 | DB00118 | SAM | 1h1d | e1h1dA1 | A:3-216 |
| P22734 | DB00118 | SAM | 1vid | e1vidA1 | A:4-216 |
| P22734 | DB00118 | SAM | 2cl5 | e2cl5A1 | A:3-216 |
| P22734 | DB00118 | SAM | 2cl5 | e2cl5B1 | B:3-215 |
| P22734 | DB00118 | SAM | 2zth | e2zthA1 | A:3-214 |
| P22734 | DB00118 | SAM | 2zvj | e2zvjA1 | A:3-214 |
| P22734 | DB00118 | SAM | 3s68 | e3s68A1 | A:1-213 |
| P22734 | DB00118 | SAM | 5fhq | e5fhqA1 | A:3-215 |
| P22734 | DB00118 | SAM | 5fhr | e5fhrA1 | A:46-258 |
| P22734 | DB00118 | SAM | 5fhr | e5fhrB1 | B:46-258 |
| P22734 | DB00118 | SAM | 6lfe | e6lfeA1 | A:3-215 |
| P22734 | DB00118 | SAM | 7xjb | e7xjbA1 | A:0-216 |
| P22734 | DB00118 | SAM | 7xjb | e7xjbB1 | B:0-216 |
| P22734 | DB00118 | SAM | 7xjb | e7xjbC1 | C:3-215 |
| P22734 | DB00118 | SAM | 7xjb | e7xjbD1 | D:3-215 |