Attributes
UniProt ID
Protein Name
Ferrochelatase, mitochondrial
Ligand Name
PROTOPORPHYRIN IX
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FEDYMSUPMFCVOD-UJJXFSCMSA-N
SMILES
Cc1c2cc3nc(cc4c(c(c([nH]4)cc5nc(cc(c1CCC(=O)O)[nH]2)C(=C5C)CCC(=O)O)C=C)C)C(=C3C)C=C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2HRE
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2hreA1e2hreA2e2hreB1e2hreB2e2hreC1e2hreC2e2hreD1e2hreD2
ECOD domains from experimental PDB structures interacting with ligand DB02285
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P22830 | DB02285 | PP9 | 2hre | e2hreA1 | A:65-228 |
| P22830 | DB02285 | PP9 | 2hre | e2hreA2 | A:229-423 |
| P22830 | DB02285 | PP9 | 2hre | e2hreB1 | B:65-228 |
| P22830 | DB02285 | PP9 | 2hre | e2hreB2 | B:229-423 |
| P22830 | DB02285 | PP9 | 2hre | e2hreC1 | C:229-423 |
| P22830 | DB02285 | PP9 | 2hre | e2hreC2 | C:65-228 |
| P22830 | DB02285 | PP9 | 2hre | e2hreD1 | D:65-228 |
| P22830 | DB02285 | PP9 | 2hre | e2hreD2 | D:229-423 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1A1 | A:229-423 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1A2 | A:65-228 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1B1 | B:229-423 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1B2 | B:65-228 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1C1 | C:229-423 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1C2 | C:65-228 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1D1 | D:229-423 |
| P22830 | DB02285 | PP9 | 2qd1 | e2qd1D2 | D:65-228 |
| P22830 | DB02285 | PP9 | 2qd5 | e2qd5A1 | A:229-423 |
| P22830 | DB02285 | PP9 | 2qd5 | e2qd5A2 | A:65-228 |
| P22830 | DB02285 | PP9 | 2qd5 | e2qd5B1 | B:565-728 |
| P22830 | DB02285 | PP9 | 2qd5 | e2qd5B2 | B:729-923 |
| P22830 | DB02285 | PP9 | 4kla | e4klaB1 | B:229-423 |
| P22830 | DB02285 | PP9 | 4kla | e4klaB2 | B:65-228 |