Attributes
UniProt ID
Protein Name
Dihydrofolate reductase
Ligand Name
NADPH DIHYDRO-NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ACFIXJIJDZMPPO-NNYOXOHSSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)N5C=CCC(=C5)C(=O)N)O)O)O)OP(=O)(O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1AI9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ai9A1e1ai9B1
ECOD domains from experimental PDB structures interacting with ligand DB02338
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P22906 | DB02338 | NDP | 1ai9 | e1ai9A1 | A:1-192 |
| P22906 | DB02338 | NDP | 1ai9 | e1ai9B1 | B:1-192 |
| P22906 | DB02338 | NDP | 1aoe | e1aoeA1 | A:1-192 |
| P22906 | DB02338 | NDP | 1aoe | e1aoeB1 | B:1-192 |
| P22906 | DB02338 | NDP | 1ia1 | e1ia1A1 | A:1-192 |
| P22906 | DB02338 | NDP | 1ia1 | e1ia1B1 | B:1-192 |
| P22906 | DB02338 | NDP | 1ia2 | e1ia2A1 | A:1-192 |
| P22906 | DB02338 | NDP | 1ia2 | e1ia2B1 | B:1-192 |
| P22906 | DB02338 | NDP | 1ia3 | e1ia3A1 | A:1-192 |
| P22906 | DB02338 | NDP | 1ia3 | e1ia3B1 | B:1-192 |
| P22906 | DB02338 | NDP | 1ia4 | e1ia4A1 | A:1-192 |
| P22906 | DB02338 | NDP | 1ia4 | e1ia4B1 | B:1-192 |
| P22906 | DB02338 | NDP | 1m78 | e1m78A1 | A:1-192 |
| P22906 | DB02338 | NDP | 1m78 | e1m78B1 | B:1-192 |
| P22906 | DB02338 | NDP | 1m79 | e1m79A1 | A:1-192 |
| P22906 | DB02338 | NDP | 1m79 | e1m79B1 | B:1-192 |
| P22906 | DB02338 | NDP | 1m7a | e1m7aA1 | A:1-192 |
| P22906 | DB02338 | NDP | 1m7a | e1m7aB1 | B:1-192 |
| P22906 | DB02338 | NDP | 4hoe | e4hoeA1 | A:1-192 |
| P22906 | DB02338 | NDP | 4hoe | e4hoeB1 | B:1-192 |
| P22906 | DB02338 | NDP | 4hof | e4hofA1 | A:1-192 |
| P22906 | DB02338 | NDP | 4hof | e4hofB1 | B:1-192 |