Attributes
UniProt ID
Protein Name
NAD-dependent malic enzyme, mitochondrial
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1GZ3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1gz3A1e1gz3A2e1gz3A3e1gz3B1e1gz3B2e1gz3B3e1gz3C1e1gz3C2e1gz3C3e1gz3D1e1gz3D2e1gz3D3
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P23368 | DB00171 | ATP | 1gz3 | e1gz3A1 | A:280-466 |
| P23368 | DB00171 | ATP | 1gz3 | e1gz3A3 | A:20-279 |
| P23368 | DB00171 | ATP | 1gz3 | e1gz3B1 | B:20-279 |
| P23368 | DB00171 | ATP | 1gz3 | e1gz3B3 | B:280-466 |
| P23368 | DB00171 | ATP | 1gz3 | e1gz3C2 | C:280-466 |
| P23368 | DB00171 | ATP | 1gz3 | e1gz3C3 | C:20-279 |
| P23368 | DB00171 | ATP | 1gz3 | e1gz3D1 | D:20-279 |
| P23368 | DB00171 | ATP | 1gz3 | e1gz3D3 | D:280-466 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4A1 | A:23-279 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4A3 | A:467-573 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4B1 | B:23-279 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4B3 | B:467-573 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4C1 | C:23-279 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4C3 | C:467-573 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4D1 | D:23-279 |
| P23368 | DB00171 | ATP | 1gz4 | e1gz4D3 | D:467-573 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4A1 | A:22-279 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4A3 | A:467-573 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4B1 | B:1022-1279 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4B3 | B:1467-1573 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4C1 | C:2022-2279 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4C3 | C:2467-2573 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4D1 | D:3022-3279 |
| P23368 | DB00171 | ATP | 1pj4 | e1pj4D3 | D:3467-3573 |