Attributes
UniProt ID
Protein Name
Thymidylate kinase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1E2D
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1e2dA1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P23919 | DB16833 | ADP | 1e2d | e1e2dA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e2e | e1e2eA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e2f | e1e2fA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e2g | e1e2gA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e98 | e1e98A1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e99 | e1e99A1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e9b | e1e9bA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e9c | e1e9cA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e9d | e1e9dA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e9e | e1e9eA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1e9f | e1e9fA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1nmx | e1nmxA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1nmy | e1nmyA1 | A:4-212 |
| P23919 | DB16833 | ADP | 1nn0 | e1nn0A1 | A:4-212 |
| P23919 | DB16833 | ADP | 1nn3 | e1nn3A1 | A:4-212 |
| P23919 | DB16833 | ADP | 2xx3 | e2xx3A1 | A:3-212 |