Attributes
UniProt ID
Protein Name
Ribonucleoside-diphosphate reductase large subunit
Ligand Name
THYMIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NHVNXKFIZYSCEB-XLPZGREQSA-N
SMILES
CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3HNC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3hncA1e3hncA2e3hncA3e3hncB2e3hncB3e3hncB4
ECOD domains from experimental PDB structures interacting with ligand DB02452
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P23921 | DB02452 | TTP | 3hnc | e3hncA2 | A:215-742 |
| P23921 | DB02452 | TTP | 3hnc | e3hncB2 | B:215-738 |
| P23921 | DB02452 | TTP | 3hnd | e3hndA1 | A:215-742 |
| P23921 | DB02452 | TTP | 3hnd | e3hndB2 | B:212-735 |
| P23921 | DB02452 | TTP | 3hne | e3hneA3 | A:215-742 |
| P23921 | DB02452 | TTP | 3hne | e3hneB2 | B:215-724 |
| P23921 | DB02452 | TTP | 3hnf | e3hnfA1 | A:215-742 |
| P23921 | DB02452 | TTP | 3hnf | e3hnfB2 | B:215-737 |
| P23921 | DB02452 | TTP | 4x3v | e4x3vA2 | A:215-742 |
| P23921 | DB02452 | TTP | 4x3v | e4x3vB2 | B:215-742 |
| P23921 | DB02452 | TTP | 5tus | e5tusA2 | A:215-742 |
| P23921 | DB02452 | TTP | 5tus | e5tusB1 | B:214-742 |
| P23921 | DB02452 | TTP | 5tus | e5tusB2 | B:96-214 |
| P23921 | DB02452 | TTP | 6l3r | e6l3rA1 | A:214-742 |
| P23921 | DB02452 | TTP | 6l3r | e6l3rE1 | E:214-742 |
| P23921 | DB02452 | TTP | 6l7l | e6l7lA2 | A:214-742 |
| P23921 | DB02452 | TTP | 6l7l | e6l7lE1 | E:214-742 |
| P23921 | DB02452 | TTP | 6lkm | e6lkmA1 | A:214-742 |
| P23921 | DB02452 | TTP | 6lkm | e6lkmB1 | B:214-742 |