Attributes
UniProt ID
Protein Name
Dr hemagglutinin structural subunit
Ligand Name
CHLORAMPHENICOL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WIIZWVCIJKGZOK-RKDXNWHRSA-N
SMILES
c1cc(ccc1C(C(CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1USQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1usqA1e1usqB1e1usqC1e1usqD1e1usqE1e1usqF1
ECOD domains from experimental PDB structures interacting with ligand DB00446
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P24093 | DB00446 | CLM | 1usq | e1usqA1 | A:0-138 |
| P24093 | DB00446 | CLM | 1usq | e1usqB1 | B:0-138 |
| P24093 | DB00446 | CLM | 1usq | e1usqC1 | C:0-138 |
| P24093 | DB00446 | CLM | 1usq | e1usqD1 | D:0-138 |
| P24093 | DB00446 | CLM | 1usq | e1usqE1 | E:0-138 |
| P24093 | DB00446 | CLM | 1usq | e1usqF1 | F:0-139 |
| P24093 | DB00446 | CLM | 2jkj | e2jkjA1 | A:0-138 |
| P24093 | DB00446 | CLM | 2jkj | e2jkjB1 | B:0-138 |
| P24093 | DB00446 | CLM | 2jkj | e2jkjC1 | C:0-138 |
| P24093 | DB00446 | CLM | 2jkj | e2jkjD1 | D:0-138 |
| P24093 | DB00446 | CLM | 2jkj | e2jkjE1 | E:0-138 |
| P24093 | DB00446 | CLM | 2jkj | e2jkjF1 | F:0-139 |
| P24093 | DB00446 | CLM | 2jkl | e2jklA1 | A:0-138 |
| P24093 | DB00446 | CLM | 2jkl | e2jklB1 | B:0-138 |
| P24093 | DB00446 | CLM | 2jkl | e2jklC1 | C:0-138 |
| P24093 | DB00446 | CLM | 2jkl | e2jklD1 | D:0-138 |
| P24093 | DB00446 | CLM | 2jkl | e2jklE1 | E:0-138 |
| P24093 | DB00446 | CLM | 2jkl | e2jklF1 | F:0-139 |