Attributes
UniProt ID
Protein Name
Biotin carboxylase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2J9G
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2j9gA1e2j9gA2e2j9gA3e2j9gB1e2j9gB2e2j9gB3
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P24182 | DB16833 | ADP | 2j9g | e2j9gB1 | B:115-330 |
| P24182 | DB16833 | ADP | 2j9g | e2j9gB2 | B:331-446 |
| P24182 | DB16833 | ADP | 3g8c | e3g8cA1 | A:115-325 |
| P24182 | DB16833 | ADP | 3g8c | e3g8cA2 | A:326-444 |
| P24182 | DB16833 | ADP | 3g8c | e3g8cB1 | B:115-325 |
| P24182 | DB16833 | ADP | 3g8c | e3g8cB2 | B:326-444 |
| P24182 | DB16833 | ADP | 3g8d | e3g8dB1 | B:115-325 |
| P24182 | DB16833 | ADP | 3g8d | e3g8dB2 | B:326-444 |
| P24182 | DB16833 | ADP | 3rup | e3rupA1 | A:115-325 |
| P24182 | DB16833 | ADP | 3rup | e3rupA2 | A:326-444 |
| P24182 | DB16833 | ADP | 3rup | e3rupB3 | B:1-114 |
| P24182 | DB16833 | ADP | 3rup | e3rupB6 | B:329-446 |
| P24182 | DB16833 | ADP | 3rup | e3rupB7 | B:115-328 |
| P24182 | DB16833 | ADP | 3rv3 | e3rv3A1 | A:115-330 |
| P24182 | DB16833 | ADP | 3rv3 | e3rv3A2 | A:331-444 |
| P24182 | DB16833 | ADP | 3rv3 | e3rv3B1 | B:112-327 |
| P24182 | DB16833 | ADP | 3rv3 | e3rv3B2 | B:328-443 |
| P24182 | DB16833 | ADP | 3rv3 | e3rv3B3 | B:1C-111 |
| P24182 | DB16833 | ADP | 3rv4 | e3rv4A6 | A:329-446 |
| P24182 | DB16833 | ADP | 3rv4 | e3rv4A7 | A:115-328 |