Attributes
UniProt ID
Protein Name
DNA replication licensing factor MCM3
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3JA8
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ja821e3ja822e3ja823e3ja824e3ja825e3ja831e3ja832e3ja833e3ja834e3ja835e3ja842e3ja843e3ja844e3ja845e3ja846e3ja851e3ja852e3ja854e3ja855e3ja856e3ja861e3ja862e3ja863e3ja864e3ja865e3ja872e3ja873e3ja874e3ja875e3ja876
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P24279 | DB16833 | ADP | 3ja8 | e3ja831 | 3:339-570 |
| P24279 | DB16833 | ADP | 3ja8 | e3ja835 | 3:651-738 |
| P24279 | DB16833 | ADP | 5bk4 | e5bk433 | 3:651-738 |
| P24279 | DB16833 | ADP | 5bk4 | e5bk435 | 3:339-570 |
| P24279 | DB16833 | ADP | 5bk4 | e5bk4B1 | B:339-570 |
| P24279 | DB16833 | ADP | 5bk4 | e5bk4B3 | B:651-738 |
| P24279 | DB16833 | ADP | 6eyc | e6eyc31 | 3:651-738 |
| P24279 | DB16833 | ADP | 6eyc | e6eyc34 | 3:339-570 |
| P24279 | DB16833 | ADP | 6f0l | e6f0l33 | 3:339-570 |
| P24279 | DB16833 | ADP | 6f0l | e6f0lB5 | B:339-570 |
| P24279 | DB16833 | ADP | 6rqc | e6rqc31 | 3:339-570 |
| P24279 | DB16833 | ADP | 6rqc | e6rqc32 | 3:651-738 |
| P24279 | DB16833 | ADP | 7p30 | e7p3031 | 3:339-570 |
| P24279 | DB16833 | ADP | 7p30 | e7p3035 | 3:651-738 |
| P24279 | DB16833 | ADP | 7p30 | e7p30B1 | B:651-738 |
| P24279 | DB16833 | ADP | 7p30 | e7p30B3 | B:339-570 |
| P24279 | DB16833 | ADP | 7p5z | e7p5z32 | 3:339-570 |
| P24279 | DB16833 | ADP | 7p5z | e7p5z33 | 3:651-738 |
| P24279 | DB16833 | ADP | 7p5z | e7p5zB2 | B:651-738 |
| P24279 | DB16833 | ADP | 7p5z | e7p5zB3 | B:339-570 |
| P24279 | DB16833 | ADP | 7v3u | e7v3u35 | 3:339-570 |
| P24279 | DB16833 | ADP | 7v3u | e7v3uC2 | C:339-570 |
| P24279 | DB16833 | ADP | 7v3v | e7v3v34 | 3:339-570 |
| P24279 | DB16833 | ADP | 7v3v | e7v3vC3 | C:339-570 |
| P24279 | DB16833 | ADP | 7w8g | e7w8g35 | 3:339-570 |
| P24279 | DB16833 | ADP | 7w8g | e7w8gC3 | C:339-570 |