Attributes
UniProt ID
Protein Name
Nitrite reductase
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1BL9
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1bl9A3e1bl9A4e1bl9B3e1bl9B4
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P24474 | DB03317 | HEC | 1bl9 | e1bl9A4 | A:7-116 |
| P24474 | DB03317 | HEC | 1bl9 | e1bl9B4 | B:7-116 |
| P24474 | DB03317 | HEC | 1gjq | e1gjqA2 | A:3-117 |
| P24474 | DB03317 | HEC | 1gjq | e1gjqB4 | B:27-116 |
| P24474 | DB03317 | HEC | 1hzu | e1hzuA3 | A:117-543 |
| P24474 | DB03317 | HEC | 1hzu | e1hzuA4 | A:23-116 |
| P24474 | DB03317 | HEC | 1hzv | e1hzvA3 | A:116-543 |
| P24474 | DB03317 | HEC | 1hzv | e1hzvA4 | A:23-115 |
| P24474 | DB03317 | HEC | 1n15 | e1n15A4 | A:28-116 |
| P24474 | DB03317 | HEC | 1n15 | e1n15B4 | B:27-116 |
| P24474 | DB03317 | HEC | 1n50 | e1n50A4 | A:28-116 |
| P24474 | DB03317 | HEC | 1n50 | e1n50B4 | B:27-116 |
| P24474 | DB03317 | HEC | 1n90 | e1n90A4 | A:28-116 |
| P24474 | DB03317 | HEC | 1n90 | e1n90B4 | B:27-116 |
| P24474 | DB03317 | HEC | 1nir | e1nirA4 | A:28-116 |
| P24474 | DB03317 | HEC | 1nir | e1nirB4 | B:27-116 |
| P24474 | DB03317 | HEC | 1nno | e1nnoA4 | A:27-116 |
| P24474 | DB03317 | HEC | 1nno | e1nnoB4 | B:27-116 |
| P24474 | DB03317 | HEC | 5guw | e5guwM1 | M:27-116 |
| P24474 | DB03317 | HEC | 5guw | e5guwN1 | N:27-116 |
| P24474 | DB03317 | HEC | 6tpo | e6tpoA1 | A:117-543 |
| P24474 | DB03317 | HEC | 6tpo | e6tpoA2 | A:21-116 |
| P24474 | DB03317 | HEC | 6tsi | e6tsiA2 | A:4-117 |
| P24474 | DB03317 | HEC | 6tsi | e6tsiB1 | B:4-117 |