Attributes
UniProt ID
Protein Name
Zinc-alpha-2-glycoprotein
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1T7V
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1t7vA1e1t7vA2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P25311 | DB00141 | NAG | 1t7v | e1t7vA1 | A:184-277 |
| P25311 | DB00141 | NAG | 1t7v | e1t7vA2 | A:5-183 |
| P25311 | DB00141 | NAG | 1t7w | e1t7wA1 | A:184-277 |
| P25311 | DB00141 | NAG | 1t7w | e1t7wA2 | A:5-183 |
| P25311 | DB00141 | NAG | 1t7x | e1t7xA1 | A:184-277 |
| P25311 | DB00141 | NAG | 1t7x | e1t7xA2 | A:5-183 |
| P25311 | DB00141 | NAG | 1t7y | e1t7yA1 | A:184-277 |
| P25311 | DB00141 | NAG | 1t7y | e1t7yA2 | A:5-183 |
| P25311 | DB00141 | NAG | 1t7z | e1t7zA1 | A:184-277 |
| P25311 | DB00141 | NAG | 1t7z | e1t7zA2 | A:5-183 |
| P25311 | DB00141 | NAG | 1t80 | e1t80A1 | A:184-277 |
| P25311 | DB00141 | NAG | 1t80 | e1t80A2 | A:5-183 |
| P25311 | DB00141 | NAG | 1zag | e1zagA2 | A:5-183 |
| P25311 | DB00141 | NAG | 1zag | e1zagB2 | B:5-183 |
| P25311 | DB00141 | NAG | 1zag | e1zagC1 | C:184-277 |
| P25311 | DB00141 | NAG | 1zag | e1zagC2 | C:6-183 |
| P25311 | DB00141 | NAG | 1zag | e1zagD1 | D:184-276 |
| P25311 | DB00141 | NAG | 1zag | e1zagD2 | D:6-183 |