Attributes
UniProt ID
Protein Name
V-type proton ATPase subunit c
Ligand Name
1,2-dioleoyl-sn-glycero-3-phosphoethanolamine
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MWRBNPKJOOWZPW-NYVOMTAGSA-N
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6M0R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6m0rB1e6m0rB2e6m0rD1e6m0rD2e6m0rE1e6m0rE2e6m0rF1e6m0rF2e6m0rG1e6m0rG2e6m0rH1e6m0rH2e6m0rI1e6m0rI2e6m0rJ1e6m0rJ2e6m0rK1e6m0rK2e6m0rL1e6m0rL2
ECOD domains from experimental PDB structures interacting with ligand DB04327
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P25515 | DB04327 | PEE | 6m0r | e6m0rE1 | E:1-81 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rE2 | E:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rF1 | F:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rF2 | F:1-81 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rG1 | G:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rG2 | G:1-81 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rH1 | H:1-81 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rH2 | H:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rI1 | I:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rI2 | I:1-81 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rJ1 | J:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rJ2 | J:1-81 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rK1 | K:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rK2 | K:1-81 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rL1 | L:82-159 |
| P25515 | DB04327 | PEE | 6m0r | e6m0rL2 | L:1-81 |