Attributes
UniProt ID
Protein Name
ATP synthase F complex subunit alpha, mitochondrial
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8H9E
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8h9eA1e8h9eA2e8h9eA3e8h9eB1e8h9eB2e8h9eB3e8h9eC1e8h9eC2e8h9eC3e8h9eD1e8h9eD2e8h9eD3e8h9eE1e8h9eE2e8h9eE3e8h9eF1e8h9eF2e8h9eF3e8h9eG1e8h9eO1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P25705 | DB16833 | ADP | 8h9e | e8h9eB1 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9e | e8h9eC2 | C:94-378 |
| P25705 | DB16833 | ADP | 8h9i | e8h9iB2 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9i | e8h9iC1 | C:94-378 |
| P25705 | DB16833 | ADP | 8h9l | e8h9lB2 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9l | e8h9lC2 | C:94-378 |
| P25705 | DB16833 | ADP | 8h9p | e8h9pB3 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9p | e8h9pC2 | C:94-378 |
| P25705 | DB16833 | ADP | 8h9s | e8h9sB2 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9s | e8h9sC2 | C:94-378 |
| P25705 | DB16833 | ADP | 8h9t | e8h9tB1 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9t | e8h9tC3 | C:94-378 |
| P25705 | DB16833 | ADP | 8h9u | e8h9uB2 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9u | e8h9uC1 | C:94-378 |
| P25705 | DB16833 | ADP | 8h9v | e8h9vB2 | B:94-378 |
| P25705 | DB16833 | ADP | 8h9v | e8h9vC3 | C:94-378 |