Attributes
UniProt ID
Protein Name
Cystic fibrosis transmembrane conductance regulator
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1R0X
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1r0xA1e1r0xB1e1r0xC1e1r0xD1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P26361 | DB00171 | ATP | 1r0x | e1r0xA1 | A:390-670 |
| P26361 | DB00171 | ATP | 1r0x | e1r0xB1 | B:390-670 |
| P26361 | DB00171 | ATP | 1r0x | e1r0xC1 | C:390-670 |
| P26361 | DB00171 | ATP | 1r0x | e1r0xD1 | D:390-670 |
| P26361 | DB00171 | ATP | 1r0z | e1r0zA1 | A:390-670 |
| P26361 | DB00171 | ATP | 1r0z | e1r0zB1 | B:390-670 |
| P26361 | DB00171 | ATP | 1r0z | e1r0zC1 | C:390-670 |
| P26361 | DB00171 | ATP | 1r0z | e1r0zD1 | D:390-670 |
| P26361 | DB00171 | ATP | 1r10 | e1r10A1 | A:391-670 |
| P26361 | DB00171 | ATP | 1r10 | e1r10B1 | B:391-670 |
| P26361 | DB00171 | ATP | 1xf9 | e1xf9A1 | A:390-670 |
| P26361 | DB00171 | ATP | 1xf9 | e1xf9B1 | B:390-670 |
| P26361 | DB00171 | ATP | 1xf9 | e1xf9C1 | C:390-670 |
| P26361 | DB00171 | ATP | 1xf9 | e1xf9D1 | D:390-670 |
| P26361 | DB00171 | ATP | 1xfa | e1xfaA1 | A:390-670 |
| P26361 | DB00171 | ATP | 1xfa | e1xfaB1 | B:390-670 |
| P26361 | DB00171 | ATP | 3si7 | e3si7A1 | A:388-670 |
| P26361 | DB00171 | ATP | 3si7 | e3si7B1 | B:388-653 |
| P26361 | DB00171 | ATP | 3si7 | e3si7C1 | C:388-653 |
| P26361 | DB00171 | ATP | 3si7 | e3si7D1 | D:388-653 |