Attributes
UniProt ID
Protein Name
Protein S100-A4
Ligand Name
10-[3-(4-METHYL-PIPERAZIN-1-YL)-PROPYL]-2-TRIFLUOROMETHYL-10H-PHENOTHIAZINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZEWQUBUPAILYHI-UHFFFAOYSA-N
SMILES
CN1CCN(CC1)CCCN2c3ccccc3Sc4c2cc(cc4)C(F)(F)F
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3KO0
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ko0A1e3ko0B1e3ko0C1e3ko0D1e3ko0E1e3ko0F1e3ko0G1e3ko0H1e3ko0I1e3ko0J1e3ko0K1e3ko0L1e3ko0M1e3ko0N1e3ko0O1e3ko0P1e3ko0Q1e3ko0R1e3ko0S1e3ko0T1
ECOD domains from experimental PDB structures interacting with ligand DB00831
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P26447 | DB00831 | TFP | 3ko0 | e3ko0A1 | A:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0B1 | B:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0C1 | C:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0D1 | D:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0E1 | E:2-93 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0F1 | F:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0G1 | G:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0H1 | H:2-95 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0I1 | I:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0J1 | J:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0K1 | K:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0L1 | L:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0M1 | M:2-93 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0N1 | N:2-93 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0O1 | O:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0P1 | P:2-93 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0Q1 | Q:2-95 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0R1 | R:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0S1 | S:2-94 |
| P26447 | DB00831 | TFP | 3ko0 | e3ko0T1 | T:2-94 |