Attributes
UniProt ID
Protein Name
Flavodoxin
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3F6R
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3f6rA1e3f6rB1e3f6rC1e3f6rD1
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P26492 | DB03247 | FMN | 3f6r | e3f6rA1 | A:2-148 |
| P26492 | DB03247 | FMN | 3f6r | e3f6rB1 | B:2-148 |
| P26492 | DB03247 | FMN | 3f6r | e3f6rC1 | C:2-148 |
| P26492 | DB03247 | FMN | 3f6r | e3f6rD1 | D:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sA1 | A:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sB1 | B:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sD1 | D:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sE1 | E:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sF1 | F:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sG1 | G:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sH1 | H:2-148 |
| P26492 | DB03247 | FMN | 3f6s | e3f6sI1 | I:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90A1 | A:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90B1 | B:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90D1 | D:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90E1 | E:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90F1 | F:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90G1 | G:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90H1 | H:2-148 |
| P26492 | DB03247 | FMN | 3f90 | e3f90I1 | I:2-148 |