Attributes
UniProt ID
Protein Name
V-type proton ATPase 16 kDa proteolipid subunit c
Ligand Name
tri(methyl)-[2-[[(2~{R})-2-[(~{Z})-octadec-9-enoyl]oxy-3-[(~{E})-1-oxidanylideneoctadec-9-enoxy]propoxy]-oxidanyl-phosphoryl]oxyethyl]azanium
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SNKAWJBJQDLSFF-TWROKUQOSA-O
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6WLW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6wlw11e6wlw12e6wlw21e6wlw22e6wlw31e6wlw32e6wlw41e6wlw42e6wlw51e6wlw52e6wlw61e6wlw62e6wlw71e6wlw72e6wlw81e6wlw82e6wlw91e6wlw92e6wlwQ1e6wlwQ2
ECOD domains from experimental PDB structures interacting with ligand WSS
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P27449 | n/a | WSS | 6wlw | e6wlw11 | 1:6-83 |
| P27449 | n/a | WSS | 6wlw | e6wlw21 | 2:84-155 |
| P27449 | n/a | WSS | 6wlw | e6wlw22 | 2:6-83 |
| P27449 | n/a | WSS | 6wlw | e6wlw31 | 3:6-83 |
| P27449 | n/a | WSS | 6wlw | e6wlw41 | 4:6-83 |
| P27449 | n/a | WSS | 6wlw | e6wlw42 | 4:84-155 |
| P27449 | n/a | WSS | 6wlw | e6wlw51 | 5:84-155 |
| P27449 | n/a | WSS | 6wlw | e6wlw52 | 5:6-83 |
| P27449 | n/a | WSS | 6wlw | e6wlw82 | 8:6-83 |
| P27449 | n/a | WSS | 6wlw | e6wlw91 | 9:6-83 |
| P27449 | n/a | WSS | 6wlw | e6wlw92 | 9:84-155 |
| P27449 | n/a | WSS | 6wm2 | e6wm212 | 1:6-83 |
| P27449 | n/a | WSS | 6wm2 | e6wm221 | 2:84-155 |
| P27449 | n/a | WSS | 6wm2 | e6wm222 | 2:6-83 |
| P27449 | n/a | WSS | 6wm2 | e6wm232 | 3:6-83 |
| P27449 | n/a | WSS | 6wm2 | e6wm241 | 4:6-83 |
| P27449 | n/a | WSS | 6wm2 | e6wm242 | 4:84-155 |
| P27449 | n/a | WSS | 6wm2 | e6wm251 | 5:6-83 |
| P27449 | n/a | WSS | 6wm2 | e6wm252 | 5:84-155 |
| P27449 | n/a | WSS | 6wm2 | e6wm272 | 7:6-83 |
| P27449 | n/a | WSS | 6wm2 | e6wm281 | 8:6-83 |
| P27449 | n/a | WSS | 6wm2 | e6wm282 | 8:84-155 |