Attributes
UniProt ID
Protein Name
Glycogen synthase isoform 2
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3O3C
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3o3cA1e3o3cA2e3o3cB1e3o3cB2e3o3cC1e3o3cC2e3o3cD1e3o3cD2
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| P27472 | DB03435 | UDP | 3o3c | e3o3cA1 | A:272-639 |
| P27472 | DB03435 | UDP | 3o3c | e3o3cB1 | B:272-639 |
| P27472 | DB03435 | UDP | 3o3c | e3o3cC2 | C:272-639 |
| P27472 | DB03435 | UDP | 3o3c | e3o3cD2 | D:272-639 |
| P27472 | DB03435 | UDP | 5sul | e5sulA2 | A:272-639 |
| P27472 | DB03435 | UDP | 5uw0 | e5uw0A1 | A:272-639 |
| P27472 | DB03435 | UDP | 5uw0 | e5uw0A2 | A:2-271 |
| P27472 | DB03435 | UDP | 5uw0 | e5uw0B1 | B:272-639 |
| P27472 | DB03435 | UDP | 5uw0 | e5uw0B2 | B:2-271 |
| P27472 | DB03435 | UDP | 5uw0 | e5uw0D1 | D:272-638 |
| P27472 | DB03435 | UDP | 5uw4 | e5uw4A1 | A:2-271 |
| P27472 | DB03435 | UDP | 5uw4 | e5uw4A2 | A:272-639 |
| P27472 | DB03435 | UDP | 5uw4 | e5uw4B2 | B:272-639 |
| P27472 | DB03435 | UDP | 5uw4 | e5uw4C1 | C:272-639 |
| P27472 | DB03435 | UDP | 5uw4 | e5uw4C2 | C:2-271 |
| P27472 | DB03435 | UDP | 5uw4 | e5uw4D1 | D:272-639 |
| P27472 | DB03435 | UDP | 5ux7 | e5ux7A2 | A:272-639 |
| P27472 | DB03435 | UDP | 5ux7 | e5ux7D1 | D:272-639 |
| P27472 | DB03435 | UDP | 5ux7 | e5ux7D2 | D:2-271 |
| P27472 | DB03435 | UDP | 5vnc | e5vncA1 | A:272-639 |
| P27472 | DB03435 | UDP | 5vnc | e5vncA2 | A:2-271 |
| P27472 | DB03435 | UDP | 5vnc | e5vncB1 | B:272-639 |
| P27472 | DB03435 | UDP | 5vnc | e5vncC1 | C:2-271 |
| P27472 | DB03435 | UDP | 5vnc | e5vncC2 | C:272-639 |
| P27472 | DB03435 | UDP | 5vnc | e5vncD2 | D:272-639 |